Difference between revisions of "PWY-6638"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=AMINO-PARATHION AMINO-PARATHION] == * smiles: ** CCOP(OC1(C=CC(=CC=1)N))(OCC)=S * inchi key: **...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6638 PWY-6638] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] *...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6638 PWY-6638] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** sulfolactate degradation III |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''3''' reactions in the full pathway |
| − | + | * [[RXN-11737]] | |
| − | == Reaction(s) | + | ** 3 associated gene(s): |
| + | *** [[Ec-03_003270]] | ||
| + | *** [[Ec-01_007480]] | ||
| + | *** [[Ec-23_003500]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=4.4.1.25-RXN 4.4.1.25-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11738 RXN-11738] | ||
== External links == | == External links == | ||
| − | + | {{#set: taxonomic range=TAX-2}} | |
| − | + | {{#set: common name=sulfolactate degradation III}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=3}} | |
| − | + | {{#set: completion rate=33.0}} | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
Latest revision as of 19:33, 21 March 2018
Pathway PWY-6638
- taxonomic range:
- common name:
- sulfolactate degradation III
- Synonym(s):
Reaction(s) found
1 reactions found over 3 reactions in the full pathway
- RXN-11737
- 3 associated gene(s):
- 2 reconstruction source(s) associated:
