Difference between revisions of "Ec-20 000540"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] == * smiles: ** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C...")
(Created page with "Category:Gene == Gene Ec-20_000540 == * left end position: ** 535523 * transcription direction: ** NEGATIVE * right end position: ** 539256 * centisome position: ** 10.385...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-236 CPD-236] ==
+
== Gene Ec-20_000540 ==
−
* smiles:
+
* left end position:
−
** C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))
+
** 535523
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** gibberellin A29
+
** 539256
−
* molecular weight:
+
* centisome position:
−
** 347.387    
+
** 10.385556    
 
* Synonym(s):
 
* Synonym(s):
−
** GA29
+
** Esi_0058_0052
 +
** Esi0058_0052
 +
** PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[PROTEIN-KINASE-RXN]]
−
* [[RXN-113]]
+
** Source: [[annotation-esiliculosus_genome]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=535523}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200412 25200412]
+
{{#set: transcription direction=NEGATIVE}}
−
* CHEBI:
+
{{#set: right end position=539256}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28040 28040]
+
{{#set: centisome position=10.385556   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0058_0052|Esi0058_0052|PK}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C06096 C06096]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: smiles=C=C1(C3(O)(CC4(C1)(C([CH]5(C2(C(=O)OC(CC(O)C2)([CH](CC3)4)5)(C)))C([O-])=O)))}}
+
−
{{#set: inchi key=InChIKey=BKBYHSYZKIAJDA-LPEMZMRWSA-M}}
+
−
{{#set: common name=gibberellin A29}}
+
−
{{#set: molecular weight=347.387   }}
+
−
{{#set: common name=GA29}}
+
−
{{#set: produced by=RXN-113}}
+

Latest revision as of 19:37, 21 March 2018

Gene Ec-20_000540

  • left end position:
    • 535523
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 539256
  • centisome position:
    • 10.385556
  • Synonym(s):
    • Esi_0058_0052
    • Esi0058_0052
    • PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-20_000540&oldid=28235"