Difference between revisions of "L-3-HYDROXYACYL-COA"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-22_002520 == * left end position: ** 2796258 * transcription direction: ** NEGATIVE * right end position: ** 2804354 * centisome position: ** 61.9...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == * smiles: ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=BILIVERDINE BILIVERDINE] == |
− | * | + | * smiles: |
− | ** | + | ** C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L |
− | * | + | * common name: |
− | ** | + | ** biliverdin-IX-α |
− | * | + | * molecular weight: |
− | ** | + | ** 580.639 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** dehydrobilirubin |
− | ** | + | ** uteroverdine |
− | ** | + | ** biliverdine |
+ | ** biliverdin | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[1.3.7.4-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00500 C00500] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57991 57991] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC57991 |
− | {{#set: | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245769 25245769] | |
+ | * HMDB : HMDB01008 | ||
+ | {{#set: smiles=C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)}} | ||
+ | {{#set: inchi key=InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L}} | ||
+ | {{#set: common name=biliverdin-IX-α}} | ||
+ | {{#set: molecular weight=580.639 }} | ||
+ | {{#set: common name=dehydrobilirubin|uteroverdine|biliverdine|biliverdin}} | ||
+ | {{#set: consumed by=1.3.7.4-RXN}} |
Revision as of 20:34, 17 March 2018
Contents
Metabolite BILIVERDINE
- smiles:
- C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)
- inchi key:
- InChIKey=QBUVFDKTZJNUPP-BBROENKCSA-L
- common name:
- biliverdin-IX-α
- molecular weight:
- 580.639
- Synonym(s):
- dehydrobilirubin
- uteroverdine
- biliverdine
- biliverdin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=CC1(=C(C)C(NC1=CC4(=C(C)C(CCC(=O)[O-])=C(C=C2(C(CCC(=O)[O-])=C(C)C(=N2)C=C3(C(C)=C(C=C)C(=O)N3)))N4))=O)" cannot be used as a page name in this wiki.