Difference between revisions of "Ec-28 003620"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6129 PWY-6129] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Pathway]] |
− | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6129 PWY-6129] == |
− | * | + | * taxonomic range: |
− | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759] |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** dolichol and dolichyl phosphate biosynthesis |
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction(s) found == |
− | + | '''1''' reactions found over '''4''' reactions in the full pathway | |
− | == Reaction(s) | + | * [[DOLICHOL-KINASE-RXN]] |
− | * [ | + | ** 1 associated gene(s): |
+ | *** [[Ec-00_001300]] | ||
+ | ** 1 reconstruction source(s) associated: | ||
+ | *** [[annotation-esiliculosus_genome]] | ||
+ | == Reaction(s) not found == | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9969 RXN-9969] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9970 RXN-9970] | ||
+ | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-9971 RXN-9971] | ||
== External links == | == External links == | ||
− | + | {{#set: taxonomic range=TAX-2759}} | |
− | + | {{#set: common name=dolichol and dolichyl phosphate biosynthesis}} | |
− | + | {{#set: reaction found=1}} | |
− | + | {{#set: total reaction=4}} | |
− | + | {{#set: completion rate=25.0}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | + | ||
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 20:35, 17 March 2018
Pathway PWY-6129
- taxonomic range:
- common name:
- dolichol and dolichyl phosphate biosynthesis
- Synonym(s):
Reaction(s) found
1 reactions found over 4 reactions in the full pathway
- DOLICHOL-KINASE-RXN
- 1 associated gene(s):
- 1 reconstruction source(s) associated: