Difference between revisions of "Ec-28 003620"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] == * smiles: ** C(S([O-])=O)C(=O)C(=O)[O-] * inchi key...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6129 PWY-6129] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-27...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-SULFINYL-PYRUVATE 3-SULFINYL-PYRUVATE] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-6129 PWY-6129] ==
−
* smiles:
+
* taxonomic range:
−
** C(S([O-])=O)C(=O)C(=O)[O-]
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2759 TAX-2759]
−
* inchi key:
+
−
** InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** 3-sulfinopyruvate
+
** dolichol and dolichyl phosphate biosynthesis
−
* molecular weight:
+
−
** 150.106   
+
 
* Synonym(s):
 
* Synonym(s):
−
** 3-sulphinyl-pyruvate
 
−
** β-sulfinylpyruvate
 
−
** 3-sulfinyl-pyruvate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
== Reaction(s) known to produce the compound ==
+
'''1''' reactions found over '''4''' reactions in the full pathway
−
== Reaction(s) of unknown directionality ==
+
* [[DOLICHOL-KINASE-RXN]]
−
* [[3-SULFINOALANINE-AMINOTRANSFERASE-RXN]]
+
** 1 associated gene(s):
 +
*** [[Ec-00_001300]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9969 RXN-9969]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9970 RXN-9970]
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN-9971 RXN-9971]
 
== External links  ==
 
== External links  ==
−
* LIGAND-CPD:
+
{{#set: taxonomic range=TAX-2759}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05527 C05527]
+
{{#set: common name=dolichol and dolichyl phosphate biosynthesis}}
−
* CHEBI:
+
{{#set: reaction found=1}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=1665 1665]
+
{{#set: total reaction=4}}
−
* METABOLIGHTS : MTBLC1665
+
{{#set: completion rate=25.0}}
−
* PUBCHEM:
+
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244536 25244536]
+
−
* HMDB : HMDB02332
+
−
{{#set: smiles=C(S([O-])=O)C(=O)C(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=JXYLQEMXCAAMOL-UHFFFAOYSA-L}}
+
−
{{#set: common name=3-sulfinopyruvate}}
+
−
{{#set: molecular weight=150.106    }}
+
−
{{#set: common name=3-sulphinyl-pyruvate|β-sulfinylpyruvate|3-sulfinyl-pyruvate}}
+
−
{{#set: consumed or produced by=3-SULFINOALANINE-AMINOTRANSFERASE-RXN}}
+

Revision as of 20:35, 17 March 2018

Pathway PWY-6129

  • taxonomic range:
  • common name:
    • dolichol and dolichyl phosphate biosynthesis
  • Synonym(s):

Reaction(s) found

1 reactions found over 4 reactions in the full pathway

Reaction(s) not found

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-28_003620&oldid=9524"