Difference between revisions of "CPD0-1108"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1108 CPD0-1108] == * smiles: ** C(C1(C(O)C(O)C(O)O1))O * common name: ** β-D-ribofura...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(C(O)C(O)C(O)O1))O | ** C(C1(C(O)C(O)C(O)O1))O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 150.131 | ** 150.131 | ||
+ | * inchi key: | ||
+ | ** InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N | ||
+ | * common name: | ||
+ | ** β-D-ribofuranose | ||
* Synonym(s): | * Synonym(s): | ||
Line 14: | Line 14: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | * [[RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.]] | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.394477.html 394477] | ** [http://www.chemspider.com/Chemical-Structure.394477.html 394477] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47002 47002] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=47002 47002] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C16639 C16639] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=447347 447347] | ||
{{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}} | {{#set: smiles=C(C1(C(O)C(O)C(O)O1))O}} | ||
− | |||
− | |||
{{#set: molecular weight=150.131 }} | {{#set: molecular weight=150.131 }} | ||
− | {{#set: reversible reaction associated= | + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N}} |
+ | {{#set: common name=β-D-ribofuranose}} | ||
+ | {{#set: reversible reaction associated=RXN-4315-CPD-4207/WATER//CPD0-1108/CPD-4209.35.}} |
Latest revision as of 11:32, 10 January 2019
Contents
Metabolite CPD0-1108
- smiles:
- C(C1(C(O)C(O)C(O)O1))O
- molecular weight:
- 150.131
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-TXICZTDVSA-N
- common name:
- β-D-ribofuranose
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links