Difference between revisions of "CPD-13390"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13390 CPD-13390] == * smiles: ** CC(C(=O)[O-])NC(=O)C(CCSC)[N+] * common name: ** L-methion...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C(=O)[O-])NC(=O)C(CCSC)[N+] | ** CC(C(=O)[O-])NC(=O)C(CCSC)[N+] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 220.286 | ** 220.286 | ||
| + | * inchi key: | ||
| + | ** InChIKey=JHKXZYLNVJRAAJ-WDSKDSINSA-N | ||
| + | * common name: | ||
| + | ** L-methionyl-L-alanine dipeptide | ||
* Synonym(s): | * Synonym(s): | ||
** L-Met-L-Ala | ** L-Met-L-Ala | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC74394 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7009580 7009580] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7009580 7009580] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74394 74394] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74394 74394] | ||
| − | * | + | * REFMET : Met-Ala |
{{#set: smiles=CC(C(=O)[O-])NC(=O)C(CCSC)[N+]}} | {{#set: smiles=CC(C(=O)[O-])NC(=O)C(CCSC)[N+]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=220.286 }} | {{#set: molecular weight=220.286 }} | ||
| + | {{#set: inchi key=InChIKey=JHKXZYLNVJRAAJ-WDSKDSINSA-N}} | ||
| + | {{#set: common name=L-methionyl-L-alanine dipeptide}} | ||
{{#set: common name=L-Met-L-Ala}} | {{#set: common name=L-Met-L-Ala}} | ||
{{#set: consumed by=RXN0-6985}} | {{#set: consumed by=RXN0-6985}} | ||
Latest revision as of 10:33, 10 January 2019
Contents
Metabolite CPD-13390
- smiles:
- CC(C(=O)[O-])NC(=O)C(CCSC)[N+]
- molecular weight:
- 220.286
- inchi key:
- InChIKey=JHKXZYLNVJRAAJ-WDSKDSINSA-N
- common name:
- L-methionyl-L-alanine dipeptide
- Synonym(s):
- L-Met-L-Ala
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)[O-])NC(=O)C(CCSC)[N+" cannot be used as a page name in this wiki.
