Difference between revisions of "CPD-13887"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13887 CPD-13887] == * smiles: ** CC(CO)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(CO)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ** CC(CO)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 400.643 | ** 400.643 | ||
+ | * inchi key: | ||
+ | ** InChIKey=CXUORUGFOXGJNY-NYJSJAOLSA-N | ||
+ | * common name: | ||
+ | ** (25S)-26-hydroxycholest-4-en-3-one | ||
* Synonym(s): | * Synonym(s): | ||
** (25S)-3-oxocholest-4-en-26-ol | ** (25S)-3-oxocholest-4-en-26-ol | ||
Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=83860 83860] |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=66932809 66932809] |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C20143 C20143] | ||
{{#set: smiles=CC(CO)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC(CO)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
− | |||
− | |||
{{#set: molecular weight=400.643 }} | {{#set: molecular weight=400.643 }} | ||
+ | {{#set: inchi key=InChIKey=CXUORUGFOXGJNY-NYJSJAOLSA-N}} | ||
+ | {{#set: common name=(25S)-26-hydroxycholest-4-en-3-one}} | ||
{{#set: common name=(25S)-3-oxocholest-4-en-26-ol}} | {{#set: common name=(25S)-3-oxocholest-4-en-26-ol}} | ||
{{#set: consumed by=RXN-12850}} | {{#set: consumed by=RXN-12850}} | ||
{{#set: produced by=RXN-12848}} | {{#set: produced by=RXN-12848}} |
Latest revision as of 10:34, 10 January 2019
Contents
Metabolite CPD-13887
- smiles:
- CC(CO)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 400.643
- inchi key:
- InChIKey=CXUORUGFOXGJNY-NYJSJAOLSA-N
- common name:
- (25S)-26-hydroxycholest-4-en-3-one
- Synonym(s):
- (25S)-3-oxocholest-4-en-26-ol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CO)CCCC(C)[CH]3(CC[CH]4([CH]2(CCC1(=CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.