Difference between revisions of "5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O] == * smiles: ** CCCCCC(O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCC(O)C=CC1(C(=O)CC(O)C(CC=CCCCC(=O)[O-])1) | ** CCCCCC(O)C=CC1(C(=O)CC(O)C(CC=CCCCC(=O)[O-])1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 351.462 | ** 351.462 | ||
| + | * inchi key: | ||
| + | ** InChIKey=BHMBVRSPMRCCGG-OUTUXVNYSA-M | ||
| + | * common name: | ||
| + | ** prostaglandin D2 | ||
* Synonym(s): | * Synonym(s): | ||
** (5z,13e)-(15s)-9-α,15-dihydroxy-11-oxoprosta-5,13-dienoate | ** (5z,13e)-(15s)-9-α,15-dihydroxy-11-oxoprosta-5,13-dienoate | ||
| Line 18: | Line 18: | ||
* [[1.1.1.188-RXN]] | * [[1.1.1.188-RXN]] | ||
== External links == | == External links == | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849124 20849124] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=20849124 20849124] | ||
| − | * | + | * REFMET : PGD2 |
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57406 57406] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57406 57406] | ||
| + | * CAS : 41598-07-6 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00696 C00696] | ** [http://www.genome.jp/dbget-bin/www_bget?C00696 C00696] | ||
| + | * HMDB : HMDB01403 | ||
{{#set: smiles=CCCCCC(O)C=CC1(C(=O)CC(O)C(CC=CCCCC(=O)[O-])1)}} | {{#set: smiles=CCCCCC(O)C=CC1(C(=O)CC(O)C(CC=CCCCC(=O)[O-])1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=351.462 }} | {{#set: molecular weight=351.462 }} | ||
| + | {{#set: inchi key=InChIKey=BHMBVRSPMRCCGG-OUTUXVNYSA-M}} | ||
| + | {{#set: common name=prostaglandin D2}} | ||
{{#set: common name=(5z,13e)-(15s)-9-α,15-dihydroxy-11-oxoprosta-5,13-dienoate}} | {{#set: common name=(5z,13e)-(15s)-9-α,15-dihydroxy-11-oxoprosta-5,13-dienoate}} | ||
{{#set: produced by=PROSTAGLANDIN-D-SYNTHASE-RXN}} | {{#set: produced by=PROSTAGLANDIN-D-SYNTHASE-RXN}} | ||
{{#set: reversible reaction associated=1.1.1.188-RXN}} | {{#set: reversible reaction associated=1.1.1.188-RXN}} | ||
Latest revision as of 10:34, 10 January 2019
Contents
Metabolite 5Z13E-15S-9-ALPHA15-DIHYDROXY-11-O
- smiles:
- CCCCCC(O)C=CC1(C(=O)CC(O)C(CC=CCCCC(=O)[O-])1)
- molecular weight:
- 351.462
- inchi key:
- InChIKey=BHMBVRSPMRCCGG-OUTUXVNYSA-M
- common name:
- prostaglandin D2
- Synonym(s):
- (5z,13e)-(15s)-9-α,15-dihydroxy-11-oxoprosta-5,13-dienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)C=CC1(C(=O)CC(O)C(CC=CCCCC(=O)[O-])1)" cannot be used as a page name in this wiki.
