Difference between revisions of "CPD-10330"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10330 CPD-10330] == * smiles: ** C(C1(C(C(C(O1)O)O)O))O * common name: ** α-D-ribofur...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(C(C(C(O1)O)O)O))O | ** C(C1(C(C(C(O1)O)O)O))O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 150.131 | ** 150.131 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N | ||
| + | * common name: | ||
| + | ** α-D-ribofuranose | ||
* Synonym(s): | * Synonym(s): | ||
** α D-ribose | ** α D-ribose | ||
| Line 16: | Line 16: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | * [[RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.]] | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=45506 45506] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=445894 445894] | ||
| + | * HMDB : HMDB00283 | ||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.5575.html 5575] | ** [http://www.chemspider.com/Chemical-Structure.5575.html 5575] | ||
| − | |||
| − | |||
| − | |||
{{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}} | {{#set: smiles=C(C1(C(C(C(O1)O)O)O))O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=150.131 }} | {{#set: molecular weight=150.131 }} | ||
| + | {{#set: inchi key=InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N}} | ||
| + | {{#set: common name=α-D-ribofuranose}} | ||
{{#set: common name=α D-ribose}} | {{#set: common name=α D-ribose}} | ||
{{#set: consumed by=RIBOKIN-RXN}} | {{#set: consumed by=RIBOKIN-RXN}} | ||
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=RXN-4315-CPD-4207/WATER//CPD-10330/CPD-4209.35.}} |
Latest revision as of 10:37, 10 January 2019
Contents
Metabolite CPD-10330
- smiles:
- C(C1(C(C(C(O1)O)O)O))O
- molecular weight:
- 150.131
- inchi key:
- InChIKey=HMFHBZSHGGEWLO-AIHAYLRMSA-N
- common name:
- α-D-ribofuranose
- Synonym(s):
- α D-ribose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
