Difference between revisions of "CPD-4581"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4581 CPD-4581] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34)))) | ** CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34)))) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 382.628 | ** 382.628 | ||
+ | * inchi key: | ||
+ | ** InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N | ||
+ | * common name: | ||
+ | ** zymosterone | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** 5α-cholesta-8,24-dien-3-one | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 17: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=52386 52386] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=22298942 22298942] | ||
+ | * REFMET : Zymosterone | ||
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}} | {{#set: smiles=CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))}} | ||
− | |||
− | |||
{{#set: molecular weight=382.628 }} | {{#set: molecular weight=382.628 }} | ||
+ | {{#set: inchi key=InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N}} | ||
+ | {{#set: common name=zymosterone}} | ||
+ | {{#set: common name=5α-cholesta-8,24-dien-3-one}} | ||
{{#set: consumed by=RXN66-319}} | {{#set: consumed by=RXN66-319}} | ||
{{#set: produced by=RXN66-318}} | {{#set: produced by=RXN66-318}} |
Latest revision as of 10:43, 10 January 2019
Contents
Metabolite CPD-4581
- smiles:
- CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))
- molecular weight:
- 382.628
- inchi key:
- InChIKey=AUNLIRXIJAVBNM-ZSBATXSLSA-N
- common name:
- zymosterone
- Synonym(s):
- 5α-cholesta-8,24-dien-3-one
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)[CH]3(CC[CH]4(C2(CC[CH]1(CC(=O)CCC(C)1C=2CCC(C)34))))" cannot be used as a page name in this wiki.