Difference between revisions of "CPD1F-115"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == * smiles: ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(CCC=C1C)(C)...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-115 CPD1F-115] == | ||
* smiles: | * smiles: | ||
| − | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C( | + | ** CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCC=C1C))C)C)C)C)C)C |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 536.882 | ** 536.882 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N | ||
| + | * common name: | ||
| + | ** δ-carotene | ||
* Synonym(s): | * Synonym(s): | ||
** ε,ψ-carotene | ** ε,ψ-carotene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[RXN1F-148]] | * [[RXN1F-148]] | ||
| + | * [[RXN-8028]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN1F-147]] | * [[RXN1F-147]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27705 27705] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281230 5281230] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5281230 5281230] | ||
| − | |||
| − | |||
* HMDB : HMDB36925 | * HMDB : HMDB36925 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C08586 C08586] | ** [http://www.genome.jp/dbget-bin/www_bget?C08586 C08586] | ||
| − | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C( | + | * CHEMSPIDER: |
| − | + | ** [http://www.chemspider.com/Chemical-Structure.4444642.html 4444642] | |
| − | + | {{#set: smiles=CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCC=C1C))C)C)C)C)C)C}} | |
{{#set: molecular weight=536.882 }} | {{#set: molecular weight=536.882 }} | ||
| + | {{#set: inchi key=InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N}} | ||
| + | {{#set: common name=δ-carotene}} | ||
{{#set: common name=ε,ψ-carotene}} | {{#set: common name=ε,ψ-carotene}} | ||
| − | {{#set: consumed by= | + | {{#set: consumed by=RXN1F-148|RXN-8028}} |
{{#set: produced by=RXN1F-147}} | {{#set: produced by=RXN1F-147}} | ||
Latest revision as of 10:44, 10 January 2019
Contents
Metabolite CPD1F-115
- smiles:
- CC(=CCCC(=CC=CC(=CC=CC(=CC=CC=C(C=CC=C(C=CC1(C(C)(C)CCC=C1C))C)C)C)C)C)C
- molecular weight:
- 536.882
- inchi key:
- InChIKey=WGIYGODPCLMGQH-GOXCNPTKSA-N
- common name:
- δ-carotene
- Synonym(s):
- ε,ψ-carotene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
