Difference between revisions of "CPD-13122"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13122 CPD-13122] == * smiles: ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O * common name: ** 4-deoxy-...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(OC(C(C(C=1)O)O)O))([O-])=O | ** C(C1(OC(C(C(C=1)O)O)O))([O-])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 175.118 | ** 175.118 | ||
+ | * inchi key: | ||
+ | ** InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M | ||
+ | * common name: | ||
+ | ** 4-deoxy-L-threo-hex-4-enopyranuronate | ||
* Synonym(s): | * Synonym(s): | ||
** (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid | ** (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid | ||
Line 18: | Line 18: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-12178]] | * [[RXN-12178]] | ||
* [[RXN-12270]] | * [[RXN-12270]] | ||
* [[RXN-12177]] | * [[RXN-12177]] | ||
+ | * [[RXN-16485]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[RXN-16512]] | * [[RXN-16512]] | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62482 62482] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62482 62482] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819971 91819971] | ||
{{#set: smiles=C(C1(OC(C(C(C=1)O)O)O))([O-])=O}} | {{#set: smiles=C(C1(OC(C(C(C=1)O)O)O))([O-])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=175.118 }} | {{#set: molecular weight=175.118 }} | ||
+ | {{#set: inchi key=InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M}} | ||
+ | {{#set: common name=4-deoxy-L-threo-hex-4-enopyranuronate}} | ||
{{#set: common name=(3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid|4-deoxy-L-threo-5-hexosulose-uronic acid|4-deoxy-L-threo-5-hexosulose-uronate|4-deoxy-L-threo-hex-4-enopyranuronate|4-deoxy-β-L-threo-hex-4-enopyranuronose}} | {{#set: common name=(3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid|4-deoxy-L-threo-5-hexosulose-uronic acid|4-deoxy-L-threo-5-hexosulose-uronate|4-deoxy-L-threo-hex-4-enopyranuronate|4-deoxy-β-L-threo-hex-4-enopyranuronose}} | ||
− | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-12178|RXN-12270|RXN-12177|RXN-16485}} |
− | {{#set: reversible reaction associated=RXN-16512 | + | {{#set: reversible reaction associated=RXN-16512}} |
Latest revision as of 11:48, 10 January 2019
Contents
Metabolite CPD-13122
- smiles:
- C(C1(OC(C(C(C=1)O)O)O))([O-])=O
- molecular weight:
- 175.118
- inchi key:
- InChIKey=IAKKJSVSFCTLRY-BAKTXGBYSA-M
- common name:
- 4-deoxy-L-threo-hex-4-enopyranuronate
- Synonym(s):
- (3R,4S)-2,3,4-trihydroxy-3,4-dihydro-2H-pyran-6-carboxylic acid
- 4-deoxy-L-threo-5-hexosulose-uronic acid
- 4-deoxy-L-threo-5-hexosulose-uronate
- 4-deoxy-L-threo-hex-4-enopyranuronate
- 4-deoxy-β-L-threo-hex-4-enopyranuronose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C=1)O)O)O))([O-])=O" cannot be used as a page name in this wiki.