Difference between revisions of "CPD-11876"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11876 CPD-11876] == * smiles: ** COC1(=C(O)C=CC(C(O)C=O)=C1) * common name: ** 3-methoxy-4-...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** COC1(=C(O)C=CC(C(O)C=O)=C1) | ** COC1(=C(O)C=CC(C(O)C=O)=C1) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 182.176 | ** 182.176 | ||
+ | * inchi key: | ||
+ | ** InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N | ||
+ | * common name: | ||
+ | ** 3-methoxy-4-hydroxyphenylglycolaldehyde | ||
* Synonym(s): | * Synonym(s): | ||
** MOPEGAL | ** MOPEGAL | ||
Line 17: | Line 17: | ||
* [[RXN-10917]] | * [[RXN-10917]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-10913]] | * [[RXN-10913]] | ||
+ | * [[RXN-10910]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
* [[RXN-10915]] | * [[RXN-10915]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.389601.html 389601] | ** [http://www.chemspider.com/Chemical-Structure.389601.html 389601] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658114 90658114] | ||
* HMDB : HMDB04061 | * HMDB : HMDB04061 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583] | ** [http://www.genome.jp/dbget-bin/www_bget?C05583 C05583] | ||
{{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}} | {{#set: smiles=COC1(=C(O)C=CC(C(O)C=O)=C1)}} | ||
− | |||
− | |||
{{#set: molecular weight=182.176 }} | {{#set: molecular weight=182.176 }} | ||
+ | {{#set: inchi key=InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N}} | ||
+ | {{#set: common name=3-methoxy-4-hydroxyphenylglycolaldehyde}} | ||
{{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}} | {{#set: common name=MOPEGAL|4-hydroxy-3-methoxymandelaldehyde|3-methoxy 4-hydroxy mandelic aldehyde}} | ||
{{#set: consumed by=RXN-10917}} | {{#set: consumed by=RXN-10917}} | ||
− | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-10913|RXN-10910}} |
{{#set: reversible reaction associated=RXN-10915}} | {{#set: reversible reaction associated=RXN-10915}} |
Latest revision as of 11:49, 10 January 2019
Contents
Metabolite CPD-11876
- smiles:
- COC1(=C(O)C=CC(C(O)C=O)=C1)
- molecular weight:
- 182.176
- inchi key:
- InChIKey=VISAJVAPYPFKCL-QMMMGPOBSA-N
- common name:
- 3-methoxy-4-hydroxyphenylglycolaldehyde
- Synonym(s):
- MOPEGAL
- 4-hydroxy-3-methoxymandelaldehyde
- 3-methoxy 4-hydroxy mandelic aldehyde
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links