Difference between revisions of "CPD0-1308"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-1308 CPD0-1308] == * smiles: ** C(NCC(=O)[O-])P(O)([O-])=O * common name: ** glyphosate *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(NCC(=O)[O-])P(O)([O-])=O | ** C(NCC(=O)[O-])P(O)([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 167.058 | ** 167.058 | ||
| + | * inchi key: | ||
| + | ** InChIKey=XDDAORKBJWWYJS-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** glyphosate | ||
* Synonym(s): | * Synonym(s): | ||
** N-(phosphonomethyl)glycine | ** N-(phosphonomethyl)glycine | ||
| Line 20: | Line 20: | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67052 67052] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=67052 67052] | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203640 25203640] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203640 25203640] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01705 C01705] | ** [http://www.genome.jp/dbget-bin/www_bget?C01705 C01705] | ||
| + | * Wikipedia : Glyphosate | ||
{{#set: smiles=C(NCC(=O)[O-])P(O)([O-])=O}} | {{#set: smiles=C(NCC(=O)[O-])P(O)([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=167.058 }} | {{#set: molecular weight=167.058 }} | ||
| + | {{#set: inchi key=InChIKey=XDDAORKBJWWYJS-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=glyphosate}} | ||
{{#set: common name=N-(phosphonomethyl)glycine|Roundup}} | {{#set: common name=N-(phosphonomethyl)glycine|Roundup}} | ||
{{#set: consumed by=RXN-17951}} | {{#set: consumed by=RXN-17951}} | ||
Latest revision as of 10:50, 10 January 2019
Contents
Metabolite CPD0-1308
- smiles:
- C(NCC(=O)[O-])P(O)([O-])=O
- molecular weight:
- 167.058
- inchi key:
- InChIKey=XDDAORKBJWWYJS-UHFFFAOYSA-L
- common name:
- glyphosate
- Synonym(s):
- N-(phosphonomethyl)glycine
- Roundup
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NCC(=O)[O-])P(O)([O-])=O" cannot be used as a page name in this wiki.
