Difference between revisions of "SHIKIMATE-5P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SHIKIMATE-5P SHIKIMATE-5P] == * smiles: ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) * com...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) | ** C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 251.109 | ** 251.109 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K | ||
| + | * common name: | ||
| + | ** shikimate 3-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** shikimate 5-phosphate | ** shikimate 5-phosphate | ||
| Line 21: | Line 21: | ||
* [[SHIKIMATE-KINASE-RXN]] | * [[SHIKIMATE-KINASE-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=145989 145989] | ||
| − | * | + | * PUBCHEM: |
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=14506806 14506806] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175] | ** [http://www.genome.jp/dbget-bin/www_bget?C03175 C03175] | ||
| + | * BIGG : skm5p | ||
{{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}} | {{#set: smiles=C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=251.109 }} | {{#set: molecular weight=251.109 }} | ||
| + | {{#set: inchi key=InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K}} | ||
| + | {{#set: common name=shikimate 3-phosphate}} | ||
{{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}} | {{#set: common name=shikimate 5-phosphate|shikimate-5-P|3-phosphoshikimate|shikimate-3-P}} | ||
{{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}} | {{#set: reversible reaction associated=2.5.1.19-RXN|SHIKIMATE-KINASE-RXN}} | ||
Latest revision as of 11:55, 10 January 2019
Contents
Metabolite SHIKIMATE-5P
- smiles:
- C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)
- molecular weight:
- 251.109
- inchi key:
- InChIKey=QYOJSKGCWNAKGW-PBXRRBTRSA-K
- common name:
- shikimate 3-phosphate
- Synonym(s):
- shikimate 5-phosphate
- shikimate-5-P
- 3-phosphoshikimate
- shikimate-3-P
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])C1(=CC(OP(=O)([O-])[O-])C(O)C(O)C1)" cannot be used as a page name in this wiki.
