Difference between revisions of "CPD-12673"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12673 CPD-12673] == * smiles: ** C(=O)([O-])C(O)C(O)C(O)CCl * common name: ** 5-chloro-5-de...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])C(O)C(O)C(O)CCl | ** C(=O)([O-])C(O)C(O)C(O)CCl | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 183.568 | ** 183.568 | ||
| + | * inchi key: | ||
| + | ** InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M | ||
| + | * common name: | ||
| + | ** 5-chloro-5-deoxy-D-ribonate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49859707 49859707] | ||
{{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}} | {{#set: smiles=C(=O)([O-])C(O)C(O)C(O)CCl}} | ||
| − | |||
| − | |||
{{#set: molecular weight=183.568 }} | {{#set: molecular weight=183.568 }} | ||
| + | {{#set: inchi key=InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M}} | ||
| + | {{#set: common name=5-chloro-5-deoxy-D-ribonate}} | ||
{{#set: consumed by=RXN-11717}} | {{#set: consumed by=RXN-11717}} | ||
Latest revision as of 10:56, 10 January 2019
Contents
Metabolite CPD-12673
- smiles:
- C(=O)([O-])C(O)C(O)C(O)CCl
- molecular weight:
- 183.568
- inchi key:
- InChIKey=IJQSOCFSKCENOW-BXXZVTAOSA-M
- common name:
- 5-chloro-5-deoxy-D-ribonate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(=O)([O-])C(O)C(O)C(O)CCl" cannot be used as a page name in this wiki.
