Difference between revisions of "8-AMINO-7-OXONONANOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=8-AMINO-7-OXONONANOATE 8-AMINO-7-OXONONANOATE] == * smiles: ** CC(C(CCCCCC([O-])=O)=O)[N+] * co...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C(CCCCCC([O-])=O)=O)[N+] | ** CC(C(CCCCCC([O-])=O)=O)[N+] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 187.238 | ** 187.238 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N | ||
| + | * common name: | ||
| + | ** 8-amino-7-oxononanoate | ||
* Synonym(s): | * Synonym(s): | ||
** 7-keto-8-aminopelargonate | ** 7-keto-8-aminopelargonate | ||
| Line 20: | Line 20: | ||
* [[DAPASYN-RXN]] | * [[DAPASYN-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57532 57532] | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244029 25244029] | ||
| + | * HMDB : HMDB37790 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C01092 C01092] | ||
| + | * BIGG : 8aonn | ||
{{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}} | {{#set: smiles=CC(C(CCCCCC([O-])=O)=O)[N+]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=187.238 }} | {{#set: molecular weight=187.238 }} | ||
| + | {{#set: inchi key=InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N}} | ||
| + | {{#set: common name=8-amino-7-oxononanoate}} | ||
{{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}} | {{#set: common name=7-keto-8-aminopelargonate|KAPA|7-KAP}} | ||
{{#set: produced by=7KAPSYN-RXN}} | {{#set: produced by=7KAPSYN-RXN}} | ||
{{#set: reversible reaction associated=DAPASYN-RXN}} | {{#set: reversible reaction associated=DAPASYN-RXN}} | ||
Latest revision as of 11:01, 10 January 2019
Contents
Metabolite 8-AMINO-7-OXONONANOATE
- smiles:
- CC(C(CCCCCC([O-])=O)=O)[N+]
- molecular weight:
- 187.238
- inchi key:
- InChIKey=GUAHPAJOXVYFON-UHFFFAOYSA-N
- common name:
- 8-amino-7-oxononanoate
- Synonym(s):
- 7-keto-8-aminopelargonate
- KAPA
- 7-KAP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(CCCCCC([O-])=O)=O)[N+" cannot be used as a page name in this wiki.
