Difference between revisions of "SULFO-CYSTEINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=SULFO-CYSTEINE SULFO-CYSTEINE] == * smiles: ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O * common name:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C([N+])C(=O)[O-])SS([O-])(=O)=O | ** C(C([N+])C(=O)[O-])SS([O-])(=O)=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 200.204 | ** 200.204 | ||
| + | * inchi key: | ||
| + | ** InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M | ||
| + | * common name: | ||
| + | ** S-sulfo-L-cysteine | ||
* Synonym(s): | * Synonym(s): | ||
** S-sulfocysteine | ** S-sulfocysteine | ||
| Line 17: | Line 17: | ||
* [[SULFOCYS-RXN]] | * [[SULFOCYS-RXN]] | ||
== External links == | == External links == | ||
| + | * REFMET : Cysteine-S-sulfate | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203408 25203408] | ||
| Line 25: | Line 26: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824] | ** [http://www.genome.jp/dbget-bin/www_bget?C05824 C05824] | ||
{{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}} | {{#set: smiles=C(C([N+])C(=O)[O-])SS([O-])(=O)=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=200.204 }} | {{#set: molecular weight=200.204 }} | ||
| + | {{#set: inchi key=InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M}} | ||
| + | {{#set: common name=S-sulfo-L-cysteine}} | ||
{{#set: common name=S-sulfocysteine}} | {{#set: common name=S-sulfocysteine}} | ||
{{#set: reversible reaction associated=SULFOCYS-RXN}} | {{#set: reversible reaction associated=SULFOCYS-RXN}} | ||
Latest revision as of 11:05, 10 January 2019
Contents
Metabolite SULFO-CYSTEINE
- smiles:
- C(C([N+])C(=O)[O-])SS([O-])(=O)=O
- molecular weight:
- 200.204
- inchi key:
- InChIKey=NOKPBJYHPHHWAN-REOHCLBHSA-M
- common name:
- S-sulfo-L-cysteine
- Synonym(s):
- S-sulfocysteine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C([N+])C(=O)[O-])SS([O-])(=O)=O" cannot be used as a page name in this wiki.
