Difference between revisions of "CPD-7087"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7087 CPD-7087] == * smiles: ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) *...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) | ** C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 319.247 | ** 319.247 | ||
+ | * inchi key: | ||
+ | ** InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M | ||
+ | * common name: | ||
+ | ** (+)-dihydromyricetin | ||
* Synonym(s): | * Synonym(s): | ||
** (+)-ampelopsin | ** (+)-ampelopsin | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
* [[RXN-7784]] | * [[RXN-7784]] | ||
+ | * [[RXN-8450]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-7922]] | * [[RXN-7922]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * | + | * METABOLIGHTS : MTBLC28429 |
− | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28429 28429] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=28429 28429] | ||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C02906 C02906] | ** [http://www.genome.jp/dbget-bin/www_bget?C02906 C02906] | ||
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244375 25244375] | ||
{{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)}} | {{#set: smiles=C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)}} | ||
− | |||
− | |||
{{#set: molecular weight=319.247 }} | {{#set: molecular weight=319.247 }} | ||
+ | {{#set: inchi key=InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M}} | ||
+ | {{#set: common name=(+)-dihydromyricetin}} | ||
{{#set: common name=(+)-ampelopsin}} | {{#set: common name=(+)-ampelopsin}} | ||
− | {{#set: consumed by=RXN- | + | {{#set: consumed by=RXN-7784|RXN-8450}} |
{{#set: produced by=RXN-7922}} | {{#set: produced by=RXN-7922}} |
Latest revision as of 11:07, 10 January 2019
Contents
Metabolite CPD-7087
- smiles:
- C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)
- molecular weight:
- 319.247
- inchi key:
- InChIKey=KJXSIXMJHKAJOD-LSDHHAIUSA-M
- common name:
- (+)-dihydromyricetin
- Synonym(s):
- (+)-ampelopsin
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C3(C(C2(OC1(C=C(C=C(C=1C(C2O)=O)O)[O-])))=CC(=C(C=3O)O)O)" cannot be used as a page name in this wiki.