Difference between revisions of "S-NORCOCLAURINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-NORCOCLAURINE S-NORCOCLAURINE] == * smiles: ** C1([N+]C(C2(=C(C1)C=C(C(=C2)O)O))CC3(=CC=C(C=C...") |
|||
| Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-NORCOCLAURINE S-NORCOCLAURINE] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=S-NORCOCLAURINE S-NORCOCLAURINE] == | ||
* smiles: | * smiles: | ||
| − | ** C1([N+] | + | ** C1([N+][CH](C2(=C(C1)C=C(C(=C2)O)O))CC3(=CC=C(C=C3)O)) |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* molecular weight: | * molecular weight: | ||
** 272.323 | ** 272.323 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WZRCQWQRFZITDX-AWEZNQCLSA-O | ||
| + | * common name: | ||
| + | ** (S)-norcoclaurine | ||
* Synonym(s): | * Synonym(s): | ||
** 1,2,3,4-tetrahydro-1-[(4-hydroxyphenyl)methyl]-6,7-isoquinolinediol | ** 1,2,3,4-tetrahydro-1-[(4-hydroxyphenyl)methyl]-6,7-isoquinolinediol | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58482 58482] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58482 58482] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229138 44229138] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C06160 C06160] | ** [http://www.genome.jp/dbget-bin/www_bget?C06160 C06160] | ||
| − | {{#set: smiles=C1([N+] | + | {{#set: smiles=C1([N+][CH](C2(=C(C1)C=C(C(=C2)O)O))CC3(=CC=C(C=C3)O))}} |
| − | + | ||
| − | + | ||
{{#set: molecular weight=272.323 }} | {{#set: molecular weight=272.323 }} | ||
| + | {{#set: inchi key=InChIKey=WZRCQWQRFZITDX-AWEZNQCLSA-O}} | ||
| + | {{#set: common name=(S)-norcoclaurine}} | ||
{{#set: common name=1,2,3,4-tetrahydro-1-[(4-hydroxyphenyl)methyl]-6,7-isoquinolinediol}} | {{#set: common name=1,2,3,4-tetrahydro-1-[(4-hydroxyphenyl)methyl]-6,7-isoquinolinediol}} | ||
{{#set: consumed by=2.1.1.128-RXN}} | {{#set: consumed by=2.1.1.128-RXN}} | ||
Latest revision as of 11:07, 10 January 2019
Contents
Metabolite S-NORCOCLAURINE
- smiles:
- C1([N+][CH](C2(=C(C1)C=C(C(=C2)O)O))CC3(=CC=C(C=C3)O))
- molecular weight:
- 272.323
- inchi key:
- InChIKey=WZRCQWQRFZITDX-AWEZNQCLSA-O
- common name:
- (S)-norcoclaurine
- Synonym(s):
- 1,2,3,4-tetrahydro-1-[(4-hydroxyphenyl)methyl]-6,7-isoquinolinediol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1([N+][CH](C2(=C(C1)C=C(C(=C2)O)O))CC3(=CC=C(C=C3)O))" cannot be used as a page name in this wiki.
"1,2,3,4-tetrahydro-1-[(4-hydroxyphenyl)methyl]-6,7-isoquinolinediol" cannot be used as a page name in this wiki.
