Difference between revisions of "CPD-11404"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11404 CPD-11404] == * smiles: ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) * co...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) | ** C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 620.928 | ** 620.928 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** 3,3',5-triiodothyroacetate | ||
* Synonym(s): | * Synonym(s): | ||
** 3,3',5-triiodothyroacetic acid | ** 3,3',5-triiodothyroacetic acid | ||
| Line 21: | Line 21: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972] | ** [http://www.chemspider.com/Chemical-Structure.10295972.html 10295972] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21679629 21679629] | ||
{{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}} | {{#set: smiles=C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=620.928 }} | {{#set: molecular weight=620.928 }} | ||
| + | {{#set: inchi key=InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=3,3',5-triiodothyroacetate}} | ||
{{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}} | {{#set: common name=3,3',5-triiodothyroacetic acid|Triac|Tiratricol|Tiracana}} | ||
{{#set: consumed by=RXN-10618|RXN-10619}} | {{#set: consumed by=RXN-10618|RXN-10619}} | ||
Latest revision as of 11:07, 10 January 2019
Contents
Metabolite CPD-11404
- smiles:
- C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))
- molecular weight:
- 620.928
- inchi key:
- InChIKey=UOWZUVNAGUAEQC-UHFFFAOYSA-M
- common name:
- 3,3',5-triiodothyroacetate
- Synonym(s):
- 3,3',5-triiodothyroacetic acid
- Triac
- Tiratricol
- Tiracana
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(=O)([O-])CC1(C=C(I)C(=C(I)C=1)OC2(=CC(I)=C(O)C=C2))" cannot be used as a page name in this wiki.
