Difference between revisions of "D-ERYTHRO-IMIDAZOLE-GLYCEROL-P"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-ERYTHRO-IMIDAZOLE-GLYCEROL-P D-ERYTHRO-IMIDAZOLE-GLYCEROL-P] == * smiles: ** C1(NC=NC=1C(C(O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O) | ** C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 236.121 | ** 236.121 | ||
| + | * inchi key: | ||
| + | ** InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L | ||
| + | * common name: | ||
| + | ** D-erythro-imidazole-glycerol-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate | ** D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate | ||
| Line 18: | Line 18: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
* [[IGPD]] | * [[IGPD]] | ||
| + | * [[IMIDPHOSDEHYD-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
* [[GLUTAMIDOTRANS-RXN]] | * [[GLUTAMIDOTRANS-RXN]] | ||
| + | * [[RXN-17900]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEMSPIDER: | ||
| + | ** [http://www.chemspider.com/Chemical-Structure.4573672.html 4573672] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459954 5459954] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459954 5459954] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58278 58278] | ||
* HMDB : HMDB12208 | * HMDB : HMDB12208 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04666 C04666] | ** [http://www.genome.jp/dbget-bin/www_bget?C04666 C04666] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* BIGG : eig3p | * BIGG : eig3p | ||
{{#set: smiles=C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)}} | {{#set: smiles=C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=236.121 }} | {{#set: molecular weight=236.121 }} | ||
| + | {{#set: inchi key=InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L}} | ||
| + | {{#set: common name=D-erythro-imidazole-glycerol-phosphate}} | ||
{{#set: common name=D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate|D-erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-phosphate|imidazole glycerol phosphate|IGP}} | {{#set: common name=D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate|D-erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-P|erythro-imidazole-glycerol-phosphate|imidazole glycerol phosphate|IGP}} | ||
| − | {{#set: consumed by=IMIDPHOSDEHYD-RXN | + | {{#set: consumed by=IGPD|IMIDPHOSDEHYD-RXN}} |
| − | {{#set: produced by= | + | {{#set: produced by=GLUTAMIDOTRANS-RXN|RXN-17900}} |
Latest revision as of 11:08, 10 January 2019
Contents
Metabolite D-ERYTHRO-IMIDAZOLE-GLYCEROL-P
- smiles:
- C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)
- molecular weight:
- 236.121
- inchi key:
- InChIKey=HFYBTHCYPKEDQQ-RITPCOANSA-L
- common name:
- D-erythro-imidazole-glycerol-phosphate
- Synonym(s):
- D-erythro-1-(imidazol-4-yl)-glycerol 3-phosphate
- D-erythro-imidazole-glycerol-P
- erythro-imidazole-glycerol-P
- erythro-imidazole-glycerol-phosphate
- imidazole glycerol phosphate
- IGP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1C(C(O)COP(=O)([O-])[O-])O)" cannot be used as a page name in this wiki.
