Difference between revisions of "CPD-15365"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15365 CPD-15365] == * smiles: ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ** CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 1041.936 | ** 1041.936 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J | ||
| + | * common name: | ||
| + | ** densipoloyl-CoA | ||
* Synonym(s): | * Synonym(s): | ||
| Line 20: | Line 20: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658551 90658551] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658551 90658551] | ||
{{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | {{#set: smiles=CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=1041.936 }} | {{#set: molecular weight=1041.936 }} | ||
| + | {{#set: inchi key=InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J}} | ||
| + | {{#set: common name=densipoloyl-CoA}} | ||
{{#set: consumed by=RXN-16153}} | {{#set: consumed by=RXN-16153}} | ||
{{#set: reversible reaction associated=RXN-16150}} | {{#set: reversible reaction associated=RXN-16150}} | ||
Latest revision as of 11:17, 10 January 2019
Contents
Metabolite CPD-15365
- smiles:
- CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- molecular weight:
- 1041.936
- inchi key:
- InChIKey=QEBZGOIPMJEISG-APEVUUACSA-J
- common name:
- densipoloyl-CoA
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCCC(O)CC=CCCCCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.
