Difference between revisions of "CPD-365"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-365 CPD-365] == * smiles: ** C1(O)(C(O)C(O)C(=O)C(O)C(O)1) * common name: ** 1-keto-D-chiro...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(O)(C(O)C(O)C(=O)C(O)C(O)1) | ** C1(O)(C(O)C(O)C(=O)C(O)C(O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 178.141 | ** 178.141 | ||
| + | * inchi key: | ||
| + | ** InChIKey=VYEGBDHSGHXOGT-QFYCRYKCSA-N | ||
| + | * common name: | ||
| + | ** 1-keto-D-chiro-inositol | ||
* Synonym(s): | * Synonym(s): | ||
** 2D-2,3,5/4,6-pentahydroxycyclohexanone | ** 2D-2,3,5/4,6-pentahydroxycyclohexanone | ||
| Line 19: | Line 19: | ||
* [[RXN-14148]] | * [[RXN-14148]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50920 50920] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=50920 50920] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12308755 12308755] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12308755 12308755] | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C20251 C20251] | ||
{{#set: smiles=C1(O)(C(O)C(O)C(=O)C(O)C(O)1)}} | {{#set: smiles=C1(O)(C(O)C(O)C(=O)C(O)C(O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=178.141 }} | {{#set: molecular weight=178.141 }} | ||
| + | {{#set: inchi key=InChIKey=VYEGBDHSGHXOGT-QFYCRYKCSA-N}} | ||
| + | {{#set: common name=1-keto-D-chiro-inositol}} | ||
{{#set: common name=2D-2,3,5/4,6-pentahydroxycyclohexanone|scyllo-inosine|(2R,3R,4S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexanone}} | {{#set: common name=2D-2,3,5/4,6-pentahydroxycyclohexanone|scyllo-inosine|(2R,3R,4S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexanone}} | ||
{{#set: reversible reaction associated=RXN-14148}} | {{#set: reversible reaction associated=RXN-14148}} | ||
Latest revision as of 11:18, 10 January 2019
Contents
Metabolite CPD-365
- smiles:
- C1(O)(C(O)C(O)C(=O)C(O)C(O)1)
- molecular weight:
- 178.141
- inchi key:
- InChIKey=VYEGBDHSGHXOGT-QFYCRYKCSA-N
- common name:
- 1-keto-D-chiro-inositol
- Synonym(s):
- 2D-2,3,5/4,6-pentahydroxycyclohexanone
- scyllo-inosine
- (2R,3R,4S,5S,6R)-2,3,4,5,6-pentahydroxycyclohexanone
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
