Difference between revisions of "CPD-8052"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8052 CPD-8052] == * smiles: ** C1(C(C(C(C(C1O)O)O)O)O)O * common name: ** 1D-chiro-inositol...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(C(C(C(C1O)O)O)O)O)O | ** C1(C(C(C(C(C1O)O)O)O)O)O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 180.157 | ** 180.157 | ||
+ | * inchi key: | ||
+ | ** InChIKey=CDAISMWEOUEBRE-LKPKBOIGSA-N | ||
+ | * common name: | ||
+ | ** 1D-chiro-inositol | ||
* Synonym(s): | * Synonym(s): | ||
** (1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol | ** (1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol | ||
Line 17: | Line 17: | ||
* [[RXN-14148]] | * [[RXN-14148]] | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27372 27372] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27372 27372] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C06150 C06150] | ||
{{#set: smiles=C1(C(C(C(C(C1O)O)O)O)O)O}} | {{#set: smiles=C1(C(C(C(C(C1O)O)O)O)O)O}} | ||
− | |||
− | |||
{{#set: molecular weight=180.157 }} | {{#set: molecular weight=180.157 }} | ||
+ | {{#set: inchi key=InChIKey=CDAISMWEOUEBRE-LKPKBOIGSA-N}} | ||
+ | {{#set: common name=1D-chiro-inositol}} | ||
{{#set: common name=(1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol}} | {{#set: common name=(1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol}} | ||
{{#set: reversible reaction associated=RXN-14148}} | {{#set: reversible reaction associated=RXN-14148}} |
Latest revision as of 12:18, 10 January 2019
Contents
Metabolite CPD-8052
- smiles:
- C1(C(C(C(C(C1O)O)O)O)O)O
- molecular weight:
- 180.157
- inchi key:
- InChIKey=CDAISMWEOUEBRE-LKPKBOIGSA-N
- common name:
- 1D-chiro-inositol
- Synonym(s):
- (1R,2R,3S,4S,5S,6S)-cyclohexane-1,2,3,4,5,6-hexol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links