Difference between revisions of "CPD-18319"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18319 CPD-18319] == * smiles: ** C(NC(=O)C1(OC(C(=O)N)1))C([N+])C(=O)[O-] * common name: **...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(NC(=O)C1(OC(C(=O)N)1))C([N+])C(=O)[O-] | ** C(NC(=O)C1(OC(C(=O)N)1))C([N+])C(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 217.181 | ** 217.181 | ||
| + | * inchi key: | ||
| + | ** InChIKey=LQRXQGMIBGPNBY-PZGQECOJSA-N | ||
| + | * common name: | ||
| + | ** N-3-(R,R)-epoxysuccinamoyl-(S)-2,3-diaminopropanoate | ||
* Synonym(s): | * Synonym(s): | ||
| Line 19: | Line 19: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515457 102515457] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515457 102515457] | ||
{{#set: smiles=C(NC(=O)C1(OC(C(=O)N)1))C([N+])C(=O)[O-]}} | {{#set: smiles=C(NC(=O)C1(OC(C(=O)N)1))C([N+])C(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=217.181 }} | {{#set: molecular weight=217.181 }} | ||
| + | {{#set: inchi key=InChIKey=LQRXQGMIBGPNBY-PZGQECOJSA-N}} | ||
| + | {{#set: common name=N-3-(R,R)-epoxysuccinamoyl-(S)-2,3-diaminopropanoate}} | ||
{{#set: consumed by=RXN-16991}} | {{#set: consumed by=RXN-16991}} | ||
Latest revision as of 11:20, 10 January 2019
Contents
Metabolite CPD-18319
- smiles:
- C(NC(=O)C1(OC(C(=O)N)1))C([N+])C(=O)[O-]
- molecular weight:
- 217.181
- inchi key:
- InChIKey=LQRXQGMIBGPNBY-PZGQECOJSA-N
- common name:
- N-3-(R,R)-epoxysuccinamoyl-(S)-2,3-diaminopropanoate
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(NC(=O)C1(OC(C(=O)N)1))C([N+])C(=O)[O-" cannot be used as a page name in this wiki.
