Difference between revisions of "CPD-14159"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == * smiles: ** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(C...")
 
 
Line 3: Line 3:
 
* smiles:
 
* smiles:
 
** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))
 
** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))
* common name:
 
** 6''-O-carbamoylkanamycin B
 
* inchi key:
 
** InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S
 
 
* molecular weight:
 
* molecular weight:
 
** 531.582     
 
** 531.582     
 +
* inchi key:
 +
** InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S
 +
* common name:
 +
** 6''-O-carbamoylkanamycin B
 
* Synonym(s):
 
* Synonym(s):
 
** nebramycin factor 4
 
** nebramycin factor 4
Line 15: Line 15:
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-15287]]
 
 
* [[RXN-14553]]
 
* [[RXN-14553]]
 +
* [[RXN-15287]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
Line 22: Line 22:
 
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658414 90658414]
 
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658414 90658414]
 
{{#set: smiles=C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))}}
 
{{#set: smiles=C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))}}
{{#set: common name=6''-O-carbamoylkanamycin B}}
 
{{#set: inchi key=InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S}}
 
 
{{#set: molecular weight=531.582    }}
 
{{#set: molecular weight=531.582    }}
 +
{{#set: inchi key=InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S}}
 +
{{#set: common name=6''-O-carbamoylkanamycin B}}
 
{{#set: common name=nebramycin factor 4|nebramycin factor IV}}
 
{{#set: common name=nebramycin factor 4|nebramycin factor IV}}
{{#set: produced by=RXN-15287|RXN-14553}}
+
{{#set: produced by=RXN-14553|RXN-15287}}

Latest revision as of 11:22, 10 January 2019

Metabolite CPD-14159

  • smiles:
    • C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))
  • molecular weight:
    • 531.582
  • inchi key:
    • InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S
  • common name:
    • 6-O-carbamoylkanamycin B
  • Synonym(s):
    • nebramycin factor 4
    • nebramycin factor IV

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))" cannot be used as a page name in this wiki.