Difference between revisions of "CPD-14159"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14159 CPD-14159] == * smiles: ** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(C...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+])) | ** C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+])) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 531.582 | ** 531.582 | ||
+ | * inchi key: | ||
+ | ** InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S | ||
+ | * common name: | ||
+ | ** 6''-O-carbamoylkanamycin B | ||
* Synonym(s): | * Synonym(s): | ||
** nebramycin factor 4 | ** nebramycin factor 4 | ||
Line 15: | Line 15: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | |||
* [[RXN-14553]] | * [[RXN-14553]] | ||
+ | * [[RXN-15287]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
Line 22: | Line 22: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658414 90658414] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90658414 90658414] | ||
{{#set: smiles=C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))}} | {{#set: smiles=C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))}} | ||
− | |||
− | |||
{{#set: molecular weight=531.582 }} | {{#set: molecular weight=531.582 }} | ||
+ | {{#set: inchi key=InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S}} | ||
+ | {{#set: common name=6''-O-carbamoylkanamycin B}} | ||
{{#set: common name=nebramycin factor 4|nebramycin factor IV}} | {{#set: common name=nebramycin factor 4|nebramycin factor IV}} | ||
− | {{#set: produced by=RXN- | + | {{#set: produced by=RXN-14553|RXN-15287}} |
Latest revision as of 11:22, 10 January 2019
Contents
Metabolite CPD-14159
- smiles:
- C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))
- molecular weight:
- 531.582
- inchi key:
- InChIKey=XCSTZNJIQFIVPE-FQSMHNGLSA-S
- common name:
- 6-O-carbamoylkanamycin B
- Synonym(s):
- nebramycin factor 4
- nebramycin factor IV
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C([N+])C1(C(O)C(O)C([N+])C(O1)OC2(C([N+])CC(C(C2O)OC3(OC(COC(=O)N)C(O)C([N+])C(O)3))[N+]))" cannot be used as a page name in this wiki.