Difference between revisions of "CPD-7417"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7417 CPD-7417] == * smiles: ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O * common n...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O | ** C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 325.294 | ** 325.294 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M | ||
| + | * common name: | ||
| + | ** cis-coumarinic acid-β-D-glucoside | ||
* Synonym(s): | * Synonym(s): | ||
** coumarinic acid glucoside | ** coumarinic acid glucoside | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62223 62223] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25796113 25796113] | ||
| + | * HMDB : HMDB60077 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05839 C05839] | ||
{{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}} | {{#set: smiles=C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=325.294 }} | {{#set: molecular weight=325.294 }} | ||
| + | {{#set: inchi key=InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M}} | ||
| + | {{#set: common name=cis-coumarinic acid-β-D-glucoside}} | ||
{{#set: common name=coumarinic acid glucoside|coumarinate glucoside}} | {{#set: common name=coumarinic acid glucoside|coumarinate glucoside}} | ||
{{#set: consumed by=RXN-8036}} | {{#set: consumed by=RXN-8036}} | ||
Latest revision as of 11:30, 10 January 2019
Contents
Metabolite CPD-7417
- smiles:
- C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O
- molecular weight:
- 325.294
- inchi key:
- InChIKey=GVRIYIMNJGULCZ-QLFWQTQQSA-M
- common name:
- cis-coumarinic acid-β-D-glucoside
- Synonym(s):
- coumarinic acid glucoside
- coumarinate glucoside
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C2(OC(OC1(C=CC=CC=1C=CC(=O)[O-]))C(C(C2O)O)O))O" cannot be used as a page name in this wiki.
