Difference between revisions of "PYRROLINE-HYDROXY-CARBOXYLATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRROLINE-HYDROXY-CARBOXYLATE PYRROLINE-HYDROXY-CARBOXYLATE] == * smiles: ** C1(=NC(C([O-])=O)C...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(=NC(C([O-])=O)CC(O)1) | ** C1(=NC(C([O-])=O)CC(O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 128.107 | ** 128.107 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M | ||
| + | * common name: | ||
| + | ** (3R,5S)-3-hydroxy-1-pyrroline-5-carboxylate | ||
* Synonym(s): | * Synonym(s): | ||
** L-Δ1-pyrroline 3-hydroxy-5-carboxylate | ** L-Δ1-pyrroline 3-hydroxy-5-carboxylate | ||
| − | ** L- | + | ** L-1-pyrroline-3-hydroxy-5-carboxylate |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62612 62612] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926300 46926300] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46926300 46926300] | ||
* HMDB : HMDB01369 | * HMDB : HMDB01369 | ||
| − | |||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04281 C04281] | ** [http://www.genome.jp/dbget-bin/www_bget?C04281 C04281] | ||
{{#set: smiles=C1(=NC(C([O-])=O)CC(O)1)}} | {{#set: smiles=C1(=NC(C([O-])=O)CC(O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=128.107 }} | {{#set: molecular weight=128.107 }} | ||
| − | {{#set: common name=L-Δ1-pyrroline 3-hydroxy-5-carboxylate|L- | + | {{#set: inchi key=InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M}} |
| + | {{#set: common name=(3R,5S)-3-hydroxy-1-pyrroline-5-carboxylate}} | ||
| + | {{#set: common name=L-Δ1-pyrroline 3-hydroxy-5-carboxylate|L-1-pyrroline-3-hydroxy-5-carboxylate}} | ||
{{#set: consumed by=RXN66-546}} | {{#set: consumed by=RXN66-546}} | ||
Latest revision as of 11:33, 10 January 2019
Contents
Metabolite PYRROLINE-HYDROXY-CARBOXYLATE
- smiles:
- C1(=NC(C([O-])=O)CC(O)1)
- molecular weight:
- 128.107
- inchi key:
- InChIKey=WFOFKRKDDKGRIK-DMTCNVIQSA-M
- common name:
- (3R,5S)-3-hydroxy-1-pyrroline-5-carboxylate
- Synonym(s):
- L-Δ1-pyrroline 3-hydroxy-5-carboxylate
- L-1-pyrroline-3-hydroxy-5-carboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(=NC(C([O-])=O)CC(O)1)" cannot be used as a page name in this wiki.
