Difference between revisions of "MYRICETIN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MYRICETIN MYRICETIN] == * smiles: ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3))) | ** C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 317.231 | ** 317.231 | ||
| + | * inchi key: | ||
| + | ** InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M | ||
| + | * common name: | ||
| + | ** myricetin | ||
* Synonym(s): | * Synonym(s): | ||
** myricitin | ** myricitin | ||
| Line 19: | Line 19: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58395 58395] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25201643 25201643] | ||
* HMDB : HMDB02755 | * HMDB : HMDB02755 | ||
| − | * | + | * REFMET : Myricetin |
| − | + | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107] | ** [http://www.genome.jp/dbget-bin/www_bget?C10107 C10107] | ||
{{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}} | {{#set: smiles=C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=317.231 }} | {{#set: molecular weight=317.231 }} | ||
| + | {{#set: inchi key=InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M}} | ||
| + | {{#set: common name=myricetin}} | ||
{{#set: common name=myricitin|cannabiscetin|myricetol}} | {{#set: common name=myricitin|cannabiscetin|myricetol}} | ||
{{#set: produced by=RXN-8450}} | {{#set: produced by=RXN-8450}} | ||
Latest revision as of 11:37, 10 January 2019
Contents
Metabolite MYRICETIN
- smiles:
- C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))
- molecular weight:
- 317.231
- inchi key:
- InChIKey=IKMDFBPHZNJCSN-UHFFFAOYSA-M
- common name:
- myricetin
- Synonym(s):
- myricitin
- cannabiscetin
- myricetol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(C(O)=C(O)C(O)=CC=1C2(OC3(C=C(O)C=C(O)C(C(=O)C([O-])=2)=3)))" cannot be used as a page name in this wiki.
