Difference between revisions of "HISTIDINAL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HISTIDINAL HISTIDINAL] == * smiles: ** C1(NC=NC=1CC([CH]=O)[N+]) * common name: ** histidinal *...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(NC=NC=1CC([CH]=O)[N+]) | ** C1(NC=NC=1CC([CH]=O)[N+]) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 140.164 | ** 140.164 | ||
| + | * inchi key: | ||
| + | ** InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O | ||
| + | * common name: | ||
| + | ** histidinal | ||
* Synonym(s): | * Synonym(s): | ||
** L-histidinal | ** L-histidinal | ||
| Line 18: | Line 18: | ||
* [[HISTOLDEHYD-RXN]] | * [[HISTOLDEHYD-RXN]] | ||
== External links == | == External links == | ||
| + | * REFMET : Histidinal | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=57339283 57339283] | ||
| Line 26: | Line 27: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929] | ** [http://www.genome.jp/dbget-bin/www_bget?C01929 C01929] | ||
{{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}} | {{#set: smiles=C1(NC=NC=1CC([CH]=O)[N+])}} | ||
| − | |||
| − | |||
{{#set: molecular weight=140.164 }} | {{#set: molecular weight=140.164 }} | ||
| + | {{#set: inchi key=InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O}} | ||
| + | {{#set: common name=histidinal}} | ||
{{#set: common name=L-histidinal}} | {{#set: common name=L-histidinal}} | ||
{{#set: consumed by=HISTALDEHYD-RXN}} | {{#set: consumed by=HISTALDEHYD-RXN}} | ||
{{#set: reversible reaction associated=HISTOLDEHYD-RXN}} | {{#set: reversible reaction associated=HISTOLDEHYD-RXN}} | ||
Latest revision as of 11:40, 10 January 2019
Contents
Metabolite HISTIDINAL
- smiles:
- C1(NC=NC=1CC([CH]=O)[N+])
- molecular weight:
- 140.164
- inchi key:
- InChIKey=VYOIELONWKIZJS-YFKPBYRVSA-O
- common name:
- histidinal
- Synonym(s):
- L-histidinal
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C1(NC=NC=1CC([CH]=O)[N+])" cannot be used as a page name in this wiki.
