Difference between revisions of "CPD-11770"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11770 CPD-11770] == * smiles: ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) * common name: **...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) | ** C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2)) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 255.233 | ** 255.233 | ||
+ | * inchi key: | ||
+ | ** InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N | ||
+ | * common name: | ||
+ | ** 7,8-dihydromonapterin | ||
* Synonym(s): | * Synonym(s): | ||
** DHM | ** DHM | ||
Line 14: | Line 14: | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-10857]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71175 71175] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71175 71175] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479435 45479435] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479435 45479435] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C21008 C21008] | ||
{{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))}} | {{#set: smiles=C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))}} | ||
− | |||
− | |||
{{#set: molecular weight=255.233 }} | {{#set: molecular weight=255.233 }} | ||
+ | {{#set: inchi key=InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N}} | ||
+ | {{#set: common name=7,8-dihydromonapterin}} | ||
{{#set: common name=DHM|H2-MPt}} | {{#set: common name=DHM|H2-MPt}} | ||
− | {{#set: | + | {{#set: consumed by=RXN-10857}} |
Latest revision as of 12:40, 10 January 2019
Contents
Metabolite CPD-11770
- smiles:
- C1(NC2(N=C(N)NC(=O)C(N=C1C(O)C(O)CO)=2))
- molecular weight:
- 255.233
- inchi key:
- InChIKey=YQIFAMYNGGOTFB-NJGYIYPDSA-N
- common name:
- 7,8-dihydromonapterin
- Synonym(s):
- DHM
- H2-MPt
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links