Difference between revisions of "RIBITOL"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=RIBITOL RIBITOL] == * smiles: ** C(O)C(O)C(O)C(O)CO * common name: ** ribitol * inchi key: ** I...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(O)C(O)C(O)C(O)CO | ** C(O)C(O)C(O)C(O)CO | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 152.147 | ** 152.147 | ||
+ | * inchi key: | ||
+ | ** InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N | ||
+ | * common name: | ||
+ | ** D-ribitol | ||
* Synonym(s): | * Synonym(s): | ||
** meso-ribitol | ** meso-ribitol | ||
** adonitol | ** adonitol | ||
** (2R,3s,4S)-pentane-1,2,3,4,5-pentol | ** (2R,3s,4S)-pentane-1,2,3,4,5-pentol | ||
− | ** | + | ** ribitol |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 20: | Line 20: | ||
* [[RIBITOL-2-DEHYDROGENASE-RXN]] | * [[RIBITOL-2-DEHYDROGENASE-RXN]] | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC15963 | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15963 15963] | ||
* CAS : 488-81-3 | * CAS : 488-81-3 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474] | ** [http://www.genome.jp/dbget-bin/www_bget?C00474 C00474] | ||
− | |||
− | |||
− | |||
* HMDB : HMDB00508 | * HMDB : HMDB00508 | ||
{{#set: smiles=C(O)C(O)C(O)C(O)CO}} | {{#set: smiles=C(O)C(O)C(O)C(O)CO}} | ||
− | |||
− | |||
{{#set: molecular weight=152.147 }} | {{#set: molecular weight=152.147 }} | ||
− | {{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol| | + | {{#set: inchi key=InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N}} |
+ | {{#set: common name=D-ribitol}} | ||
+ | {{#set: common name=meso-ribitol|adonitol|(2R,3s,4S)-pentane-1,2,3,4,5-pentol|ribitol}} | ||
{{#set: reversible reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}} | {{#set: reversible reaction associated=RIBITOL-2-DEHYDROGENASE-RXN}} |
Latest revision as of 12:43, 10 January 2019
Contents
Metabolite RIBITOL
- smiles:
- C(O)C(O)C(O)C(O)CO
- molecular weight:
- 152.147
- inchi key:
- InChIKey=HEBKCHPVOIAQTA-ZXFHETKHSA-N
- common name:
- D-ribitol
- Synonym(s):
- meso-ribitol
- adonitol
- (2R,3s,4S)-pentane-1,2,3,4,5-pentol
- ribitol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links