Difference between revisions of "STRICTOSIDINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=STRICTOSIDINE STRICTOSIDINE] == * smiles: ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3)))...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO)) | ** C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO)) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 531.581 | ** 531.581 | ||
| − | * | + | * inchi key: |
| + | ** InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O | ||
| + | * common name: | ||
** 3-α(S)-strictosidine | ** 3-α(S)-strictosidine | ||
| + | * Synonym(s): | ||
| + | ** strictosidine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17559 17559] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44123291 44123291] | ||
| + | * CAS : 20824-29-7 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470] | ** [http://www.genome.jp/dbget-bin/www_bget?C03470 C03470] | ||
{{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}} | {{#set: smiles=C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=531.581 }} | {{#set: molecular weight=531.581 }} | ||
| + | {{#set: inchi key=InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O}} | ||
{{#set: common name=3-α(S)-strictosidine}} | {{#set: common name=3-α(S)-strictosidine}} | ||
| + | {{#set: common name=strictosidine}} | ||
{{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}} | {{#set: produced by=STRICTOSIDINE-SYNTHASE-RXN}} | ||
Latest revision as of 11:45, 10 January 2019
Contents
Metabolite STRICTOSIDINE
- smiles:
- C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))
- molecular weight:
- 531.581
- inchi key:
- InChIKey=XBAMJZTXGWPTRM-AWTFMMIESA-O
- common name:
- 3-α(S)-strictosidine
- Synonym(s):
- strictosidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C[CH]4([CH](C[CH]3(C2(NC1(=CC=CC=C1C=2CC[N+]3))))C(C(=O)OC)=COC4OC5(OC(C(C(C5O)O)O)CO))" cannot be used as a page name in this wiki.
