Difference between revisions of "CPD-18447"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-18447 CPD-18447] == * smiles: ** CC1(=CC=C(C(=O)[O-])C2(N=C3(C(OC1=2)=C(C)C(=O)C(N)=C(C(=O)...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC1(=CC=C(C(=O)[O-])C2(N=C3(C(OC1=2)=C(C)C(=O)C(N)=C(C(=O)[O-])3))) | ** CC1(=CC=C(C(=O)[O-])C2(N=C3(C(OC1=2)=C(C)C(=O)C(N)=C(C(=O)[O-])3))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 326.265 | ** 326.265 | ||
| + | * inchi key: | ||
| + | ** InChIKey=KXRMREPJUITWDU-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** actinocin | ||
* Synonym(s): | * Synonym(s): | ||
** 2-amino-4,6-dimethyl-3-oxo-3H-phenoxazine-1,9-dicarboxylate | ** 2-amino-4,6-dimethyl-3-oxo-3H-phenoxazine-1,9-dicarboxylate | ||
| Line 17: | Line 17: | ||
* [[RXN-17077]] | * [[RXN-17077]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEMSPIDER: | * CHEMSPIDER: | ||
** [http://www.chemspider.com/Chemical-Structure.86817.html 86817] | ** [http://www.chemspider.com/Chemical-Structure.86817.html 86817] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514952 102514952] | ||
{{#set: smiles=CC1(=CC=C(C(=O)[O-])C2(N=C3(C(OC1=2)=C(C)C(=O)C(N)=C(C(=O)[O-])3)))}} | {{#set: smiles=CC1(=CC=C(C(=O)[O-])C2(N=C3(C(OC1=2)=C(C)C(=O)C(N)=C(C(=O)[O-])3)))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=326.265 }} | {{#set: molecular weight=326.265 }} | ||
| + | {{#set: inchi key=InChIKey=KXRMREPJUITWDU-UHFFFAOYSA-L}} | ||
| + | {{#set: common name=actinocin}} | ||
{{#set: common name=2-amino-4,6-dimethyl-3-oxo-3H-phenoxazine-1,9-dicarboxylate}} | {{#set: common name=2-amino-4,6-dimethyl-3-oxo-3H-phenoxazine-1,9-dicarboxylate}} | ||
{{#set: reversible reaction associated=RXN-17077}} | {{#set: reversible reaction associated=RXN-17077}} | ||
Latest revision as of 11:50, 10 January 2019
Contents
Metabolite CPD-18447
- smiles:
- CC1(=CC=C(C(=O)[O-])C2(N=C3(C(OC1=2)=C(C)C(=O)C(N)=C(C(=O)[O-])3)))
- molecular weight:
- 326.265
- inchi key:
- InChIKey=KXRMREPJUITWDU-UHFFFAOYSA-L
- common name:
- actinocin
- Synonym(s):
- 2-amino-4,6-dimethyl-3-oxo-3H-phenoxazine-1,9-dicarboxylate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=CC=C(C(=O)[O-])C2(N=C3(C(OC1=2)=C(C)C(=O)C(N)=C(C(=O)[O-])3)))" cannot be used as a page name in this wiki.
