Difference between revisions of "CPD-510"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-510 CPD-510] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O * common name:...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O | ** C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 271.097 | ** 271.097 | ||
| + | * inchi key: | ||
| + | ** InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K | ||
| + | * common name: | ||
| + | ** α-D-glucuronate 1-phosphate | ||
* Synonym(s): | * Synonym(s): | ||
** glucuronate-1-P | ** glucuronate-1-P | ||
| Line 21: | Line 21: | ||
* [[2.7.7.44-RXN]] | * [[2.7.7.44-RXN]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57897 57897] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57897 57897] | ||
| − | |||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244365 25244365] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244365 25244365] | ||
| + | * HMDB : HMDB03976 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05385 C05385] | ||
| + | * BIGG : glcur1p | ||
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O}} | {{#set: smiles=C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=271.097 }} | {{#set: molecular weight=271.097 }} | ||
| + | {{#set: inchi key=InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K}} | ||
| + | {{#set: common name=α-D-glucuronate 1-phosphate}} | ||
{{#set: common name=glucuronate-1-P|glucuronate-1-phosphate|D-glucuronate-1-P|D-glucuronate-1-phosphate|1-phospho-α-D-glucuronate}} | {{#set: common name=glucuronate-1-P|glucuronate-1-phosphate|D-glucuronate-1-P|D-glucuronate-1-phosphate|1-phospho-α-D-glucuronate}} | ||
{{#set: reversible reaction associated=2.7.7.44-RXN}} | {{#set: reversible reaction associated=2.7.7.44-RXN}} | ||
Latest revision as of 11:51, 10 January 2019
Contents
Metabolite CPD-510
- smiles:
- C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O
- molecular weight:
- 271.097
- inchi key:
- InChIKey=AIQDYKMWENWVQJ-QIUUJYRFSA-K
- common name:
- α-D-glucuronate 1-phosphate
- Synonym(s):
- glucuronate-1-P
- glucuronate-1-phosphate
- D-glucuronate-1-P
- D-glucuronate-1-phosphate
- 1-phospho-α-D-glucuronate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O))([O-])=O" cannot be used as a page name in this wiki.
