Difference between revisions of "CPD66-21"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD66-21 CPD66-21] == * smiles: ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O | ** CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 495.653 | ** 495.653 | ||
| + | * inchi key: | ||
| + | ** InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M | ||
| + | * common name: | ||
| + | ** leukotriene-D4 | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63166 63166] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=52940265 52940265] | ||
| + | * REFMET : LTD4 | ||
{{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}} | {{#set: smiles=CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=495.653 }} | {{#set: molecular weight=495.653 }} | ||
| + | {{#set: inchi key=InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M}} | ||
| + | {{#set: common name=leukotriene-D4}} | ||
{{#set: produced by=RXN66-336}} | {{#set: produced by=RXN66-336}} | ||
Latest revision as of 11:56, 10 January 2019
Contents
Metabolite CPD66-21
- smiles:
- CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O
- molecular weight:
- 495.653
- inchi key:
- InChIKey=YEESKJGWJFYOOK-IJHYULJSSA-M
- common name:
- leukotriene-D4
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC=CCC=CC=CC=CC(SCC(C(=O)NCC([O-])=O)[N+])C(CCCC([O-])=O)O" cannot be used as a page name in this wiki.
