Difference between revisions of "CPDQT-36"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPDQT-36 CPDQT-36] == * smiles: ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] * common name: ** 3-(3'-met...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] | ** C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 220.24 | ** 220.24 | ||
| + | * inchi key: | ||
| + | ** InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L | ||
| + | * common name: | ||
| + | ** 3-[(3'-methylthio)propyl]malate | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** 3-(3'-methylthio) | + | ** 3-[(3'-methylthio)propyl]malic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 18: | Line 18: | ||
* [[RXN-18208]] | * [[RXN-18208]] | ||
== External links == | == External links == | ||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133501 133501] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=133501 133501] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237292 44237292] | ||
{{#set: smiles=C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]}} | {{#set: smiles=C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=220.24 }} | {{#set: molecular weight=220.24 }} | ||
| − | {{#set: common name=3-(3'-methylthio) | + | {{#set: inchi key=InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L}} |
| + | {{#set: common name=3-[(3'-methylthio)propyl]malate}} | ||
| + | {{#set: common name=3-[(3'-methylthio)propyl]malic acid}} | ||
{{#set: consumed by=RXNQT-4165}} | {{#set: consumed by=RXNQT-4165}} | ||
{{#set: reversible reaction associated=RXN-18208}} | {{#set: reversible reaction associated=RXN-18208}} | ||
Latest revision as of 11:57, 10 January 2019
Contents
Metabolite CPDQT-36
- smiles:
- C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-]
- molecular weight:
- 220.24
- inchi key:
- InChIKey=SQXVIIOPMYSNCP-UHFFFAOYSA-L
- common name:
- 3-[(3'-methylthio)propyl]malate
- Synonym(s):
- 3-[(3'-methylthio)propyl]malic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(C(CCCSC)C(O)C(=O)[O-])(=O)[O-" cannot be used as a page name in this wiki.
"3-[(3'-methylthio)propyl]malate" cannot be used as a page name in this wiki.
"3-[(3'-methylthio)propyl]malic acid" cannot be used as a page name in this wiki.
