Difference between revisions of "CPD-19217"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-19217 CPD-19217] == * smiles: ** C(SNO)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O * common...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(SNO)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ** C(SNO)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 337.327 | ** 337.327 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ZOIIDZWLSVVTGQ-WDSKDSINSA-M | ||
| + | * common name: | ||
| + | ** S-(hydroxysulfenamide)-glutathione | ||
* Synonym(s): | * Synonym(s): | ||
** GSNHOH | ** GSNHOH | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
* [[RXN-17884]] | * [[RXN-17884]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=122706006 122706006] | ||
{{#set: smiles=C(SNO)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | {{#set: smiles=C(SNO)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=337.327 }} | {{#set: molecular weight=337.327 }} | ||
| + | {{#set: inchi key=InChIKey=ZOIIDZWLSVVTGQ-WDSKDSINSA-M}} | ||
| + | {{#set: common name=S-(hydroxysulfenamide)-glutathione}} | ||
{{#set: common name=GSNHOH}} | {{#set: common name=GSNHOH}} | ||
| − | |||
{{#set: produced by=RXN-17884}} | {{#set: produced by=RXN-17884}} | ||
Latest revision as of 11:57, 10 January 2019
Contents
Metabolite CPD-19217
- smiles:
- C(SNO)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
- molecular weight:
- 337.327
- inchi key:
- InChIKey=ZOIIDZWLSVVTGQ-WDSKDSINSA-M
- common name:
- S-(hydroxysulfenamide)-glutathione
- Synonym(s):
- GSNHOH
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C(SNO)C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O" cannot be used as a page name in this wiki.
