Difference between revisions of "CPD-11937"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11937 CPD-11937] == * smiles: ** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-]...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1) | ** C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 727.921 | ** 727.921 | ||
| + | * inchi key: | ||
| + | ** InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B | ||
| + | * common name: | ||
| + | ** 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate | ||
* Synonym(s): | * Synonym(s): | ||
** 3-PP-InsP5 | ** 3-PP-InsP5 | ||
| Line 19: | Line 19: | ||
* [[RXN-10971]] | * [[RXN-10971]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
* [[RXN-10976]] | * [[RXN-10976]] | ||
| + | * [[RXN-10978]] | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173206 46173206] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173206 46173206] | ||
{{#set: smiles=C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)}} | {{#set: smiles=C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)}} | ||
| − | |||
| − | |||
{{#set: molecular weight=727.921 }} | {{#set: molecular weight=727.921 }} | ||
| + | {{#set: inchi key=InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B}} | ||
| + | {{#set: common name=1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate}} | ||
{{#set: common name=3-PP-InsP5|3-diphospho-1D-myo-inositol pentakisphosphate|3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate}} | {{#set: common name=3-PP-InsP5|3-diphospho-1D-myo-inositol pentakisphosphate|3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate}} | ||
{{#set: consumed by=RXN-10973}} | {{#set: consumed by=RXN-10973}} | ||
{{#set: produced by=RXN-10971}} | {{#set: produced by=RXN-10971}} | ||
| − | {{#set: reversible reaction associated=RXN- | + | {{#set: reversible reaction associated=RXN-10976|RXN-10978}} |
Latest revision as of 13:00, 10 January 2019
Contents
Metabolite CPD-11937
- smiles:
- C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)
- molecular weight:
- 727.921
- inchi key:
- InChIKey=UPHPWXPNZIOZJL-PTQMNWPWSA-B
- common name:
- 1D-myo-inositol 3-diphosphate 1,2,4,5,6-pentakisphosphate
- Synonym(s):
- 3-PP-InsP5
- 3-diphospho-1D-myo-inositol pentakisphosphate
- 3-diphospho-1D-myo-inositol 1,2,4,5,6-pentakisphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"C1(OP([O-])(=O)[O-])(C(OP([O-])(=O)[O-])C(OP(=O)([O-])[O-])C(OP(=O)([O-])OP(O)(=O)[O-])C(OP([O-])([O-])=O)C(OP([O-])([O-])=O)1)" cannot be used as a page name in this wiki.
