Difference between revisions of "5-OXOPROLINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-OXOPROLINE 5-OXOPROLINE] == * smiles: ** C(=O)(C1(NC(CC1)=O))[O-] * common name: ** 5-oxo-L-p...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(=O)(C1(NC(CC1)=O))[O-] | ** C(=O)(C1(NC(CC1)=O))[O-] | ||
| + | * molecular weight: | ||
| + | ** 128.107 | ||
| + | * inchi key: | ||
| + | ** InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M | ||
* common name: | * common name: | ||
** 5-oxo-L-proline | ** 5-oxo-L-proline | ||
| − | |||
| − | |||
| − | |||
| − | |||
* Synonym(s): | * Synonym(s): | ||
** pyrrolidone-COO | ** pyrrolidone-COO | ||
| Line 14: | Line 14: | ||
** L-5-pyrrolidone-2-carboxylic acid | ** L-5-pyrrolidone-2-carboxylic acid | ||
** L-pyroglutamic acid | ** L-pyroglutamic acid | ||
| − | |||
** pyroglutamic acid | ** pyroglutamic acid | ||
** pyroglutamate | ** pyroglutamate | ||
** 5-pyrrolidone-2-carboxylic acid | ** 5-pyrrolidone-2-carboxylic acid | ||
** L-pyroglutamate | ** L-pyroglutamate | ||
| − | ** | + | ** pidolic acid |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| Line 28: | Line 27: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | * | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.4451146.html 4451146] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289118 5289118] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5289118 5289118] | ||
| − | * | + | * CHEBI: |
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58402 58402] | ||
| + | * GO-TERMS : (REFMET "Pyroglutamic acid" NIL midford 3701443689 NIL NIL) | ||
| + | * CAS : 98-79-3 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01879 C01879] | ** [http://www.genome.jp/dbget-bin/www_bget?C01879 C01879] | ||
| − | * | + | * HMDB : HMDB00267 |
| − | + | ||
| − | + | ||
| − | + | ||
{{#set: smiles=C(=O)(C1(NC(CC1)=O))[O-]}} | {{#set: smiles=C(=O)(C1(NC(CC1)=O))[O-]}} | ||
| + | {{#set: molecular weight=128.107 }} | ||
| + | {{#set: inchi key=InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M}} | ||
{{#set: common name=5-oxo-L-proline}} | {{#set: common name=5-oxo-L-proline}} | ||
| − | + | {{#set: common name=pyrrolidone-COO|pyrrolidone-carboxylate|L-5-pyrrolidone-2-carboxylic acid|L-pyroglutamic acid|pyroglutamic acid|pyroglutamate|5-pyrrolidone-2-carboxylic acid|L-pyroglutamate|pidolic acid}} | |
| − | + | ||
| − | {{#set: common name=pyrrolidone-COO|pyrrolidone-carboxylate|L-5-pyrrolidone-2-carboxylic acid|L-pyroglutamic acid | + | |
{{#set: consumed by=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}} | {{#set: consumed by=5-OXOPROLINASE-ATP-HYDROLYSING-RXN}} | ||
{{#set: produced by=GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN|RXN-15681}} | {{#set: produced by=GAMMA-GLUTAMYLCYCLOTRANSFERASE-RXN|RXN-15681}} | ||
Latest revision as of 12:06, 10 January 2019
Contents
Metabolite 5-OXOPROLINE
- smiles:
- C(=O)(C1(NC(CC1)=O))[O-]
- molecular weight:
- 128.107
- inchi key:
- InChIKey=ODHCTXKNWHHXJC-VKHMYHEASA-M
- common name:
- 5-oxo-L-proline
- Synonym(s):
- pyrrolidone-COO
- pyrrolidone-carboxylate
- L-5-pyrrolidone-2-carboxylic acid
- L-pyroglutamic acid
- pyroglutamic acid
- pyroglutamate
- 5-pyrrolidone-2-carboxylic acid
- L-pyroglutamate
- pidolic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEMSPIDER:
- PUBCHEM:
- CHEBI:
- GO-TERMS : (REFMET "Pyroglutamic acid" NIL midford 3701443689 NIL NIL)
- CAS : 98-79-3
- LIGAND-CPD:
- HMDB : HMDB00267
"C(=O)(C1(NC(CC1)=O))[O-" cannot be used as a page name in this wiki.
