Difference between revisions of "CPD-5923"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-5923 CPD-5923] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))F * common nam...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))F | ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))F | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 269.235 | ** 269.235 | ||
| + | * inchi key: | ||
| + | ** InChIKey=QPVLKMICBYRPSX-KQYNXXCUSA-N | ||
| + | * common name: | ||
| + | ** 5'-deoxy-5'-fluoroadenosine | ||
* Synonym(s): | * Synonym(s): | ||
| Line 16: | Line 16: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12060 12060] | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=448403 448403] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C19766 C19766] | ||
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))F}} | {{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))F}} | ||
| − | |||
| − | |||
{{#set: molecular weight=269.235 }} | {{#set: molecular weight=269.235 }} | ||
| + | {{#set: inchi key=InChIKey=QPVLKMICBYRPSX-KQYNXXCUSA-N}} | ||
| + | {{#set: common name=5'-deoxy-5'-fluoroadenosine}} | ||
{{#set: consumed by=RXN-11743}} | {{#set: consumed by=RXN-11743}} | ||
Latest revision as of 12:09, 10 January 2019
Contents
Metabolite CPD-5923
- smiles:
- C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))F
- molecular weight:
- 269.235
- inchi key:
- InChIKey=QPVLKMICBYRPSX-KQYNXXCUSA-N
- common name:
- 5'-deoxy-5'-fluoroadenosine
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
