Difference between revisions of "CPD-729"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] == * smiles: ** CCC=CCC1(C(=O)C=CC(CCCCCCCC([O-])=O)1) * common name: ** 12-ox...") |
|||
Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-729 CPD-729] == | ||
* smiles: | * smiles: | ||
− | ** CCC=CCC1(C( | + | ** CCC=CCC1(C(C=CC(=O)1)CCCCCCCC([O-])=O) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
** 291.409 | ** 291.409 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PMTMAFAPLCGXGK-JMTMCXQRSA-M | ||
+ | * common name: | ||
+ | ** 12-oxo-cis-10,15-phytodienoate | ||
* Synonym(s): | * Synonym(s): | ||
** 12-oxo-cis-10,15-phytodienoic acid | ** 12-oxo-cis-10,15-phytodienoic acid | ||
Line 21: | Line 21: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57411 57411] |
+ | * PUBCHEM: | ||
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266620 45266620] | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01226 C01226] | ** [http://www.genome.jp/dbget-bin/www_bget?C01226 C01226] | ||
− | {{#set: smiles=CCC=CCC1(C( | + | {{#set: smiles=CCC=CCC1(C(C=CC(=O)1)CCCCCCCC([O-])=O)}} |
− | + | ||
− | + | ||
{{#set: molecular weight=291.409 }} | {{#set: molecular weight=291.409 }} | ||
+ | {{#set: inchi key=InChIKey=PMTMAFAPLCGXGK-JMTMCXQRSA-M}} | ||
+ | {{#set: common name=12-oxo-cis-10,15-phytodienoate}} | ||
{{#set: common name=12-oxo-cis-10,15-phytodienoic acid|oxophytodienoic acid|(15Z)-12-oxophyto-10,15-dienoate|12-oxo-phytodienoic acid|12-OPDA}} | {{#set: common name=12-oxo-cis-10,15-phytodienoic acid|oxophytodienoic acid|(15Z)-12-oxophyto-10,15-dienoate|12-oxo-phytodienoic acid|12-OPDA}} | ||
{{#set: consumed by=12-OXOPHYTODIENOATE-REDUCTASE-RXN}} | {{#set: consumed by=12-OXOPHYTODIENOATE-REDUCTASE-RXN}} |
Latest revision as of 13:10, 10 January 2019
Contents
Metabolite CPD-729
- smiles:
- CCC=CCC1(C(C=CC(=O)1)CCCCCCCC([O-])=O)
- molecular weight:
- 291.409
- inchi key:
- InChIKey=PMTMAFAPLCGXGK-JMTMCXQRSA-M
- common name:
- 12-oxo-cis-10,15-phytodienoate
- Synonym(s):
- 12-oxo-cis-10,15-phytodienoic acid
- oxophytodienoic acid
- (15Z)-12-oxophyto-10,15-dienoate
- 12-oxo-phytodienoic acid
- 12-OPDA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC1(C(C=CC(=O)1)CCCCCCCC([O-])=O)" cannot be used as a page name in this wiki.