Difference between revisions of "4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON] == * smiles:...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34)))) | ** CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 398.671 | ** 398.671 | ||
+ | * inchi key: | ||
+ | ** InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N | ||
+ | * common name: | ||
+ | ** 4α-methyl-5α-cholest-7-en-3-one | ||
* Synonym(s): | * Synonym(s): | ||
Line 14: | Line 14: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
* [[1.1.1.170-RXN]] | * [[1.1.1.170-RXN]] | ||
+ | * [[1.1.1.270-RXN]] | ||
== External links == | == External links == | ||
+ | * CHEBI: | ||
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16495 16495] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=440345 440345] | ||
− | |||
− | |||
* HMDB : HMDB11606 | * HMDB : HMDB11606 | ||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453] | ** [http://www.genome.jp/dbget-bin/www_bget?C04453 C04453] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.389311.html 389311] | ||
{{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
− | |||
− | |||
{{#set: molecular weight=398.671 }} | {{#set: molecular weight=398.671 }} | ||
− | {{#set: reversible reaction associated=1.1.1. | + | {{#set: inchi key=InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N}} |
+ | {{#set: common name=4α-methyl-5α-cholest-7-en-3-one}} | ||
+ | {{#set: reversible reaction associated=1.1.1.170-RXN|1.1.1.270-RXN}} |
Latest revision as of 13:12, 10 January 2019
Contents
Metabolite 4-ALPHA-METHYL-5-ALPHA-CHOLEST-7-EN-3-ON
- smiles:
- CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 398.671
- inchi key:
- InChIKey=OWKGVPXWOHLTSL-LIUJFMQASA-N
- common name:
- 4α-methyl-5α-cholest-7-en-3-one
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCC[CH](C)[CH]3(CC[CH]4(C2(=CC[CH]1(C(C)C(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.