Difference between revisions of "CPD-13684"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13684 CPD-13684] == * smiles: ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CC...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ** CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34)))) | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 384.644 | ** 384.644 | ||
| + | * inchi key: | ||
| + | ** InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N | ||
| + | * common name: | ||
| + | ** cholest-5-en-3-one | ||
* Synonym(s): | * Synonym(s): | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[RXN-12693]] | ||
== External links == | == External links == | ||
| + | * METABOLIGHTS : MTBLC63906 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9908107 9908107] | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=63906 63906] | ||
| − | * | + | * REFMET : 3-ketocholesterol |
{{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | {{#set: smiles=CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}} | ||
| − | |||
| − | |||
{{#set: molecular weight=384.644 }} | {{#set: molecular weight=384.644 }} | ||
| − | {{#set: | + | {{#set: inchi key=InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N}} |
| + | {{#set: common name=cholest-5-en-3-one}} | ||
| + | {{#set: reversible reaction associated=RXN-12693}} | ||
Latest revision as of 12:13, 10 January 2019
Contents
Metabolite CPD-13684
- smiles:
- CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
- molecular weight:
- 384.644
- inchi key:
- InChIKey=GGCLNOIGPMGLDB-GYKMGIIDSA-N
- common name:
- cholest-5-en-3-one
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC(C)[CH]3(CC[CH]4([CH]2(CC=C1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
