Difference between revisions of "CPD-15280"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15280 CPD-15280] == * smiles: ** C[N+](C)(C)C(CC1(=CNC=N1))C(=O)[O-] * common name: ** herc...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** C[N+](C)(C)C(CC1(=CNC=N1))C(=O)[O-] | ** C[N+](C)(C)C(CC1(=CNC=N1))C(=O)[O-] | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 197.236 | ** 197.236 | ||
+ | * inchi key: | ||
+ | ** InChIKey=GPPYTCRVKHULJH-QMMMGPOBSA-N | ||
+ | * common name: | ||
+ | ** hercynine | ||
* Synonym(s): | * Synonym(s): | ||
** Nα,Nα,Nα-trimethyl-L-histidine | ** Nα,Nα,Nα-trimethyl-L-histidine | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15781 15781] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15781 15781] | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459798 5459798] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459798 5459798] | ||
+ | * HMDB : HMDB29422 | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05575 C05575] | ||
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.4573570.html 4573570] | ||
{{#set: smiles=C[N+](C)(C)C(CC1(=CNC=N1))C(=O)[O-]}} | {{#set: smiles=C[N+](C)(C)C(CC1(=CNC=N1))C(=O)[O-]}} | ||
− | |||
− | |||
{{#set: molecular weight=197.236 }} | {{#set: molecular weight=197.236 }} | ||
+ | {{#set: inchi key=InChIKey=GPPYTCRVKHULJH-QMMMGPOBSA-N}} | ||
+ | {{#set: common name=hercynine}} | ||
{{#set: common name=Nα,Nα,Nα-trimethyl-L-histidine}} | {{#set: common name=Nα,Nα,Nα-trimethyl-L-histidine}} | ||
{{#set: consumed by=RXN-14430}} | {{#set: consumed by=RXN-14430}} |
Latest revision as of 13:14, 10 January 2019
Contents
Metabolite CPD-15280
- smiles:
- C[N+](C)(C)C(CC1(=CNC=N1))C(=O)[O-]
- molecular weight:
- 197.236
- inchi key:
- InChIKey=GPPYTCRVKHULJH-QMMMGPOBSA-N
- common name:
- hercynine
- Synonym(s):
- Nα,Nα,Nα-trimethyl-L-histidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C[N+](C)(C)C(CC1(=CNC=N1))C(=O)[O-" cannot be used as a page name in this wiki.