Difference between revisions of "CPD-11519"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)...") |
|||
Line 2: | Line 2: | ||
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11519 CPD-11519] == | ||
* smiles: | * smiles: | ||
− | ** CCC= | + | ** CCC=CCC1(C(CCC(=O)1)CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])=O) |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* molecular weight: | * molecular weight: | ||
** 1055.92 | ** 1055.92 | ||
+ | * inchi key: | ||
+ | ** InChIKey=PDDHCVXPABQISO-XJJFHSEKSA-J | ||
+ | * common name: | ||
+ | ** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** OPC8-3-hydroxyacyl-CoA |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 19: | Line 19: | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=126961152 126961152] |
− | {{#set: smiles=CCC= | + | {{#set: smiles=CCC=CCC1(C(CCC(=O)1)CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])=O)}} |
− | + | ||
− | + | ||
{{#set: molecular weight=1055.92 }} | {{#set: molecular weight=1055.92 }} | ||
− | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1- | + | {{#set: inchi key=InChIKey=PDDHCVXPABQISO-XJJFHSEKSA-J}} |
+ | {{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA}} | ||
+ | {{#set: common name=OPC8-3-hydroxyacyl-CoA}} | ||
{{#set: consumed by=RXN-10698}} | {{#set: consumed by=RXN-10698}} | ||
{{#set: produced by=RXN-10697}} | {{#set: produced by=RXN-10697}} |
Latest revision as of 12:14, 10 January 2019
Contents
Metabolite CPD-11519
- smiles:
- CCC=CCC1(C(CCC(=O)1)CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])=O)
- molecular weight:
- 1055.92
- inchi key:
- InChIKey=PDDHCVXPABQISO-XJJFHSEKSA-J
- common name:
- 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-(3R-hydroxyoctanoyl)-CoA
- Synonym(s):
- OPC8-3-hydroxyacyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- PUBCHEM:
"CCC=CCC1(C(CCC(=O)1)CCCCCC(O)CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-])=O)" cannot be used as a page name in this wiki.