Difference between revisions of "CPD-667"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-667 CPD-667] == * smiles: ** CC(OCCC(C([O-])=O)[N+])=O * common name: ** O-acetyl-L-homoser...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(OCCC(C([O-])=O)[N+])=O | ** CC(OCCC(C([O-])=O)[N+])=O | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 161.157 | ** 161.157 | ||
| + | * inchi key: | ||
| + | ** InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N | ||
| + | * common name: | ||
| + | ** O-acetyl-L-homoserine | ||
* Synonym(s): | * Synonym(s): | ||
** acetylhomoserine | ** acetylhomoserine | ||
| Line 18: | Line 18: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[HOMOSERINE-O-ACETYLTRANSFERASE-RXN]] | ||
* [[ACETYLHOMOSER-CYS-RXN]] | * [[ACETYLHOMOSER-CYS-RXN]] | ||
| − | |||
== External links == | == External links == | ||
| − | * | + | * METABOLIGHTS : MTBLC57716 |
| − | + | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57716 57716] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57716 57716] | ||
| − | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C01077 C01077] | ** [http://www.genome.jp/dbget-bin/www_bget?C01077 C01077] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244888 25244888] | ||
{{#set: smiles=CC(OCCC(C([O-])=O)[N+])=O}} | {{#set: smiles=CC(OCCC(C([O-])=O)[N+])=O}} | ||
| − | |||
| − | |||
{{#set: molecular weight=161.157 }} | {{#set: molecular weight=161.157 }} | ||
| + | {{#set: inchi key=InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N}} | ||
| + | {{#set: common name=O-acetyl-L-homoserine}} | ||
{{#set: common name=acetylhomoserine|O-acetylhomoserine}} | {{#set: common name=acetylhomoserine|O-acetylhomoserine}} | ||
{{#set: consumed by=ACHMSSELCYSL|ACHMSSELCYSLh}} | {{#set: consumed by=ACHMSSELCYSL|ACHMSSELCYSLh}} | ||
| − | {{#set: reversible reaction associated= | + | {{#set: reversible reaction associated=HOMOSERINE-O-ACETYLTRANSFERASE-RXN|ACETYLHOMOSER-CYS-RXN}} |
Latest revision as of 12:15, 10 January 2019
Contents
Metabolite CPD-667
- smiles:
- CC(OCCC(C([O-])=O)[N+])=O
- molecular weight:
- 161.157
- inchi key:
- InChIKey=FCXZBWSIAGGPCB-YFKPBYRVSA-N
- common name:
- O-acetyl-L-homoserine
- Synonym(s):
- acetylhomoserine
- O-acetylhomoserine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(OCCC(C([O-])=O)[N+])=O" cannot be used as a page name in this wiki.
