Difference between revisions of "CPD-61"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-61 CPD-61] == * smiles: ** CC(C(=O)[O-])C(C)(O)C(=O)[O-] * common name: ** (2R,3S)-2,3-dime...") |
|||
| Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C(=O)[O-])C(C)(O)C(=O)[O-] | ** CC(C(=O)[O-])C(C)(O)C(=O)[O-] | ||
| − | |||
| − | |||
| − | |||
| − | |||
* molecular weight: | * molecular weight: | ||
** 160.126 | ** 160.126 | ||
| + | * inchi key: | ||
| + | ** InChIKey=WTIIULQJLZEHGZ-CVYQJGLWSA-L | ||
| + | * common name: | ||
| + | ** (2R,3S)-2,3-dimethylmalate | ||
* Synonym(s): | * Synonym(s): | ||
** (2R,3S)-dimethylmalate | ** (2R,3S)-dimethylmalate | ||
| Line 18: | Line 18: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | |||
| − | |||
| − | |||
| − | |||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15582 15582] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15582 15582] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200436 25200436] | ||
| + | * CAS : 31519-20-7 | ||
| + | * CAS : 73522-92-6 | ||
* LIGAND-CPD: | * LIGAND-CPD: | ||
** [http://www.genome.jp/dbget-bin/www_bget?C03652 C03652] | ** [http://www.genome.jp/dbget-bin/www_bget?C03652 C03652] | ||
{{#set: smiles=CC(C(=O)[O-])C(C)(O)C(=O)[O-]}} | {{#set: smiles=CC(C(=O)[O-])C(C)(O)C(=O)[O-]}} | ||
| − | |||
| − | |||
{{#set: molecular weight=160.126 }} | {{#set: molecular weight=160.126 }} | ||
| + | {{#set: inchi key=InChIKey=WTIIULQJLZEHGZ-CVYQJGLWSA-L}} | ||
| + | {{#set: common name=(2R,3S)-2,3-dimethylmalate}} | ||
{{#set: common name=(2R,3S)-dimethylmalate|2,3-dimethylmalate}} | {{#set: common name=(2R,3S)-dimethylmalate|2,3-dimethylmalate}} | ||
{{#set: consumed by=23-DIMETHYLMALATE-LYASE-RXN}} | {{#set: consumed by=23-DIMETHYLMALATE-LYASE-RXN}} | ||
Latest revision as of 12:18, 10 January 2019
Contents
Metabolite CPD-61
- smiles:
- CC(C(=O)[O-])C(C)(O)C(=O)[O-]
- molecular weight:
- 160.126
- inchi key:
- InChIKey=WTIIULQJLZEHGZ-CVYQJGLWSA-L
- common name:
- (2R,3S)-2,3-dimethylmalate
- Synonym(s):
- (2R,3S)-dimethylmalate
- 2,3-dimethylmalate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C(=O)[O-])C(C)(O)C(=O)[O-" cannot be used as a page name in this wiki.
