Difference between revisions of "CPD-13398"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13398 CPD-13398] == * smiles: ** CC(C)CC(C([O-])=O)NC(C(C)[N+])=O * common name: ** L-alany...") |
|||
Line 3: | Line 3: | ||
* smiles: | * smiles: | ||
** CC(C)CC(C([O-])=O)NC(C(C)[N+])=O | ** CC(C)CC(C([O-])=O)NC(C(C)[N+])=O | ||
− | |||
− | |||
− | |||
− | |||
* molecular weight: | * molecular weight: | ||
** 202.253 | ** 202.253 | ||
+ | * inchi key: | ||
+ | ** InChIKey=RDIKFPRVLJLMER-BQBZGAKWSA-N | ||
+ | * common name: | ||
+ | ** L-alanyl-L-leucine | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Ala-Leu |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
Line 17: | Line 17: | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
+ | * METABOLIGHTS : MTBLC73770 | ||
* PUBCHEM: | * PUBCHEM: | ||
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992128 6992128] | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6992128 6992128] | ||
+ | * HMDB : HMDB28691 | ||
* CHEBI: | * CHEBI: | ||
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74389 74389] | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74389 74389] | ||
− | |||
− | |||
{{#set: smiles=CC(C)CC(C([O-])=O)NC(C(C)[N+])=O}} | {{#set: smiles=CC(C)CC(C([O-])=O)NC(C(C)[N+])=O}} | ||
− | |||
− | |||
{{#set: molecular weight=202.253 }} | {{#set: molecular weight=202.253 }} | ||
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=RDIKFPRVLJLMER-BQBZGAKWSA-N}} |
+ | {{#set: common name=L-alanyl-L-leucine}} | ||
+ | {{#set: common name=Ala-Leu}} | ||
{{#set: consumed by=RXN0-6979}} | {{#set: consumed by=RXN0-6979}} |
Latest revision as of 13:26, 10 January 2019
Contents
Metabolite CPD-13398
- smiles:
- CC(C)CC(C([O-])=O)NC(C(C)[N+])=O
- molecular weight:
- 202.253
- inchi key:
- InChIKey=RDIKFPRVLJLMER-BQBZGAKWSA-N
- common name:
- L-alanyl-L-leucine
- Synonym(s):
- Ala-Leu
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CC(C([O-])=O)NC(C(C)[N+])=O" cannot be used as a page name in this wiki.